answersLogoWhite

0

Chloramphenicol is a complicated molecule with the SMILES formula c1cc(ccc1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-]. If you don't read SMILES, that's probably not especially helpful.

"suspforulation" isn't a real word; I suspect it refers to the formulation and just means that the chloramphenicol is in a water suspension.

User Avatar

Wiki User

9y ago

What else can I help you with?

Related Questions

When water evaporates its chemical composition?

The chemical composition remain unchanged.


What is the diffence between physical and chemical properties as well an physical and chemical changes?

Physical properties can be observed without changing the chemical composition of a substance. Chemical properties can only be observed by changing the chemical composition of the substance. In a physical change, the chemical composition of the substance does not change. In a chemical change, the chemical composition of the substance changes.


The groups of rocks are classified by?

i think is chemical composition its not chemical composition, it's how they were formed


Groups of rocks are classified by?

i think is chemical composition its not chemical composition, it's how they were formed


Are rocks a chemical makeup?

Yes, the composition of the rocks is as a result of the distinct chemical composition.


Does melting ice changes the chemical composition of water?

The chemical composition of water remain unchanged.


What happens to the composition of matter when matter undergoes a chemical change?

A chemical change involve a change of composition.


What is the difference between a liquid and its chemical composition?

A liquid is a compound or a mixture; the chemical composition is representative for this liquid.


Is it true that chemical properties of matter cannot be determined from the composition of matter alone.?

Several chemical properties can be estimated knowing the chemical composition.


What is composition of KF reagent?

What is the chemical composition of kf reagent


What property of a mineral is determined by its chemical composition?

The color of a mineral sample is determined by its chemical composition


What is weathering that does not alter the chemical composition of the rock called?

The type of weathering that does not alter the chemical composition of the rock is called physical weathering. The acid weathering usually alter the chemical composition of a rock.