Chloramphenicol is a complicated molecule with the SMILES formula c1cc(ccc1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-]. If you don't read SMILES, that's probably not especially helpful.
"suspforulation" isn't a real word; I suspect it refers to the formulation and just means that the chloramphenicol is in a water suspension.
The chemical composition remain unchanged.
i think is chemical composition its not chemical composition, it's how they were formed
The chemical composition of water remain unchanged.
A chemical change involve a change of composition.
A liquid is a compound or a mixture; the chemical composition is representative for this liquid.
The chemical composition remain unchanged.
Physical properties can be observed without changing the chemical composition of a substance. Chemical properties can only be observed by changing the chemical composition of the substance. In a physical change, the chemical composition of the substance does not change. In a chemical change, the chemical composition of the substance changes.
i think is chemical composition its not chemical composition, it's how they were formed
i think is chemical composition its not chemical composition, it's how they were formed
Yes, the composition of the rocks is as a result of the distinct chemical composition.
The chemical composition of water remain unchanged.
A chemical change involve a change of composition.
A liquid is a compound or a mixture; the chemical composition is representative for this liquid.
Several chemical properties can be estimated knowing the chemical composition.
The color of a mineral sample is determined by its chemical composition
The type of weathering that does not alter the chemical composition of the rock is called physical weathering. The acid weathering usually alter the chemical composition of a rock.
It is a chemical change (reaction) because the chemical composition of the products (O2 and H2) is different from the chemical composition of the water (H2O).