answersLogoWhite

0

Chloramphenicol is a complicated molecule with the SMILES formula c1cc(ccc1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-]. If you don't read SMILES, that's probably not especially helpful.

"suspforulation" isn't a real word; I suspect it refers to the formulation and just means that the chloramphenicol is in a water suspension.

User Avatar

Wiki User

10y ago

What else can I help you with?

Related Questions

When water evaporates its chemical composition?

The chemical composition remain unchanged.


What is the diffence between physical and chemical properties as well an physical and chemical changes?

Physical properties can be observed without changing the chemical composition of a substance. Chemical properties can only be observed by changing the chemical composition of the substance. In a physical change, the chemical composition of the substance does not change. In a chemical change, the chemical composition of the substance changes.


Are rocks a chemical makeup?

Yes, the composition of the rocks is as a result of the distinct chemical composition.


Groups of rocks are classified by?

i think is chemical composition its not chemical composition, it's how they were formed


The groups of rocks are classified by?

i think is chemical composition its not chemical composition, it's how they were formed


Does melting ice changes the chemical composition of water?

The chemical composition of water remain unchanged.


What is the difference between a liquid and its chemical composition?

A liquid is a compound or a mixture; the chemical composition is representative for this liquid.


What happens to the composition of matter when matter undergoes a chemical change?

A chemical change involve a change of composition.


Is it true that chemical properties of matter cannot be determined from the composition of matter alone.?

Several chemical properties can be estimated knowing the chemical composition.


What property of a mineral is determined by its chemical composition?

The color of a mineral sample is determined by its chemical composition


What is weathering that does not alter the chemical composition of the rock called?

The type of weathering that does not alter the chemical composition of the rock is called physical weathering. The acid weathering usually alter the chemical composition of a rock.


Why is it chemical when water is separated into o2 and h2?

It is a chemical change (reaction) because the chemical composition of the products (O2 and H2) is different from the chemical composition of the water (H2O).