answersLogoWhite

0

What else can I help you with?

Related Questions

What is the function of glutamate in the human body?

ftgtfhnyjytjty


What is the most common neurotransmitter in the human body?

The most common neurotransmitter in the human body is glutamate. It is an excitatory neurotransmitter that plays a key role in learning and memory.


What are four molecules in the body?

Here are 4 molecules found in the human body: water, glucose, ammonia and glutamate.


Is it deadly when Monosodium glutamate is mixed with beer?

Glutamate has a very low acute toxicity under normal circumstances; the oral dose that is lethal to 50% of subjects (LD50) in rats and mice is ~15,000--18,000 mg/kg body weight, respectively. Normally spoken when a salt is consumed by a human it is dissolved, whether it's in pure water or in water contaminated with alcohol. Death by saltcaused-dehydration has an extremely painful trajectory.


How much amount of monosodium glutamate is safe to eat?

The acceptable daily intake (ADI) of monosodium glutamate (MSG) is generally considered to be about 0.5 to 1.0 grams per kilogram of body weight, according to the Joint FAO/WHO Expert Committee on Food Additives. For the average adult, this translates to a safe intake of several grams per day. Most studies suggest that moderate consumption of MSG is safe for most people, but some individuals may experience sensitivity or adverse reactions. It's always best to consume it in moderation.


What function does human growth do in your body?

no we can measure the growth of our human body


What are the function of diamonds in human body?

There are no diamonds in the human body. The body could not digest them.


Can the human body function without you?

no


What is the function of the keyword in the human body?

The function of the kidney in the human body is to filter waste and excess fluids from the blood to form urine.


What is the function of hind limbs on human body?

The function is locomotion.


If glutamic acid has the formula HC5H8NO4 then what is the formula of sodium glutamate commonly known as MSG or monosodium glutamate?

MSG, 2-aminopentanedioic acid, is C5H8NNaO4 and has a SMILES (simplified molecular input line entry specification) of C(CC(=O)O)C(C(=O)O-)N.[Na+]. A link is provided to the Wikipedia article on MSG.


What organ in the human body serves the same function of the onion?

What organ in the human body with similar function