0
I would call it something like 2-bromo propanoic acid
Wiki User
∙ 14y ago
Abdullah Anwar
Wiki User
∙ 14y agoThe compound Br-CH2-CH=CH2 is 3-bromo propene.
Abdullah Anwar
Because this compund known as ( Ethyl Bromide)
Wiki User
∙ 14y agoThe IUPAC name is 1,3-dibromobutane
Wiki User
∙ 14y agoIt is 2-bromo pentane
Wiki User
∙ 6y agoThis compound is bromobutane.
Add your answer:
Earn +20 pts
How will convert n-propylbromide into iso-propylbromide?
CH3-CH2-CH2-Br + KOH(alcoholic) = CH3-CH=CH2 + KCl + H2O CH3-CH=CH2 + HBr = CH3-CH(Br)-CH3 Markonikov's rule
What is the complete structural formula for 1-2-Dibromoethane?
Br Br | |H - C - C - H| |H H
How do you convery propanoic acid to ethanoic acid?
onvert the ethyl bromide into Grignard's reagent, ethyl magnesium bromide then allow to react with dry ice (Solid carbon dioxide) then acidic hydrolysis produces the propionic acid. CH3-Br + Mg --- anhydrous ether---> CH3-CH2-Mg-Br CH3-CH2-Mg-Br + CO2 ----H+/H2O---> CH3-CH2-COOH
What are the products of the reaction of 1 3-butadiene with Br2 and H2O?
CH2=CH2-CH-CH2-Br 1-butene, 3- OH, 4-Br | OH Not sure but would be my best bet
Can CH3-CHCH-Br exhibit a cis- trans isomerization?
The molecule CH3-HC=CH-Br can exist either in the cis or trans configuration.
What is the name of the Compound CH2Br?
Ethylbromide is the name of the compound CH3-CH2-Br.
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
What is the IUPAC name for ch3-ch equals ch-ch3?
The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.
How will convert n-propylbromide into iso-propylbromide?
CH3-CH2-CH2-Br + KOH(alcoholic) = CH3-CH=CH2 + KCl + H2O CH3-CH=CH2 + HBr = CH3-CH(Br)-CH3 Markonikov's rule
The equation for the reaction between 2-pentene and bromine?
CH3-CH=CH-CH2-CH3 + Br2 = CH3-CH(Br)-CH(Br)-CH2-CH3
What is the complete structural formula for 1-2-Dibromoethane?
Br Br | |H - C - C - H| |H H
How will you synthesise ethyl bromide into propionic acid?
Convert the ethyl bromide into Grignard's reagent, ethyl magnesium bromide then allow to react with dry ice (Solid carbon dioxide) then acidic hydrolysis produces the propionic acid. CH3-Br + Mg --- anhydrous ether---> CH3-CH2-Mg-Br CH3-CH2-Mg-Br + CO2 ----H+/H2O---> CH3-CH2-COOH
How do you convert n-propylbromide to 2.3-dimethylbutane?
1-dehydrohalogenation of n-propylbromide which gives the propene. CH3-CH2-CH2-Br + KOH(Alcoholic) -----> CH3-CH=CH2 2-again hydrohalogenation with HBr gives mostly iso-propylbromide,(Markonikov's rule). CH3-CH=CH2 + HBr ------> CH3-CHBr-CH3 3-The reaction of iso-propylbromide with Sodium metal in presence of anhydrous ether (Wurtz reaction) gives the 2,3-dimethylbutane. 2(CH3-CHBr-CH3) + 2Na ---anhydrous ether--->CH3-CHCH3-CHCH3-CH3
What is the structural formula of 1-bromo-3-hexyne?
Br-CH2-CH2-C=-C-CH2-CH3
How is 1-bromobutane reacts with sodium hydroxide?
Ch3ch2ch2ch2br + NaOH -> ch3ch2ch2ch2oh + NaBr
How do you convery propanoic acid to ethanoic acid?
onvert the ethyl bromide into Grignard's reagent, ethyl magnesium bromide then allow to react with dry ice (Solid carbon dioxide) then acidic hydrolysis produces the propionic acid. CH3-Br + Mg --- anhydrous ether---> CH3-CH2-Mg-Br CH3-CH2-Mg-Br + CO2 ----H+/H2O---> CH3-CH2-COOH
What happens when bromine water is used to test for unstauration?
The redish brown bromine color disappears by the addition of bromine to double bond.Br2 + H2C==CH-(CH2)n-CH3 ----> H2C(Br)--CH(Br)-(CH2)n-CH31-alkene ----> 1,2-dibroom-alkane
