answersLogoWhite

0

CH3-CH=CH-CH2-CH3 + Br2 = CH3-CH(Br)-CH(Br)-CH2-CH3

User Avatar

Wiki User

15y ago

What else can I help you with?

Related Questions

What is the equation for the reaction between bromine and potassium chloride?

The equation for the reaction between bromine and potassium chloride is: 2KCl + Br2 -> 2KBr + Cl2


What is the balanced chemical equation between neon and bromine?

Any reaction occur between neon and bromine.


What is the balanced equation of bromine and acetylene reaction?

The chemical reaction is:C2H2 + Br2 = CHBr=CHBr


What is the balance reaction equation of bromine and sodium thiosulfate?

The balanced chemical equation for the reaction between bromine and sodium thiosulfate is: 2Na2S2O3 + Br2 → 2NaBr + Na2S4O6. This reaction is often used in titrations to determine the concentration of bromine in a solution.


The equation for the single displacement reaction between bromine and calcium iodide?

The equation for the single displacement reaction between bromine and calcium iodide is: Br2 + CaI2 -> 2CaBr2 + I2


Skeleton equation of barium bromine?

The skeleton equation for the reaction between barium and bromine would be: Ba + Br2 -> BaBr2.


What is the word equation for the reaction bromine and potassium iodide?

Bromine and Potassium iodide react to form Potassium bromide and Iodine.


What is the woed equation for the reaction of aluminium and bromine?

Aluminium metal reacts with bromine gas to form aluminium tribromide. 2Al + 3Br2 ==> 2AlBr3


What is the symbol equation for sodium and bromine?

Sodium + Bromine ----> Sodium bromide2 Na + Br2 ----> 2 NaBr


Chlorine and bromine balanced equation?

The balanced chemical equation for the reaction between chlorine (Cl2) and bromine (Br2) is: Cl2 + Br2 -> 2ClBr


What is equation for the reaction between silver and bromine?

The reaction between silver and bromine can be represented by the chemical equation: 2Ag + Br2 → 2AgBr. This shows that two atoms of silver react with one molecule of bromine to form two molecules of silver bromide.


What is the equation reaction for cyclohexene bromine in dichloromethane?

The reaction between cyclohexene and bromine in dichloromethane results in the addition of bromine across the double bond in cyclohexene to form 1,2-dibromocyclohexane. The balanced chemical equation can be represented as: C6H10 + Br2 → C6H10Br2.