answersLogoWhite

0

Ch3 -ch2 -o-c(o)-ch2-ch2-ch2-ch2-ch2-ch2-ch3

User Avatar

Wiki User

∙ 13y ago

What else can I help you with?

Related Questions

How many ml of 0.315 m NaOH are needed to complete hydrolyze 2.840g ethyl octanoate?

How many of 0.325 are needed to complete hydrolyze (saponify) 2.800 ethyl octanoate?


If you boil ethyl alcohol does the chemical structure change?

No. The chemical structure of ethyl alcohol gas is the same as ethyl alcohol liquid.


What is the structure of ethyl alcohol?

Ethyl alcohol, also known as ethanol, has a simple structure with a carbon chain of two carbons (ethyl group) bonded to a hydroxyl group (OH). It is a colorless liquid with a molecular formula of C2H5OH.


What is the correct structure of 3-ethyl-3-methylhexane?

The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3


What is the chemical structure of 2-ethyl-3-methyloxirane and how is it used in industrial applications?

The chemical structure of 2-ethyl-3-methyloxirane is a three-membered ring with an oxygen atom and ethyl and methyl groups attached. It is commonly known as ethyl methyl oxirane or ethyl methyl epoxide. This compound is used in industrial applications as a precursor for the production of various chemicals, including plastics, resins, and pharmaceuticals. It is also used as a solvent and in the synthesis of other organic compounds.


What is dash structure of ethyl hydrogen sulphate?

Ethyl Hydrogen Sulphate should look CH3-CH2-O-[S(=O)(=O)(-O-H)]


What is the structures of ethyl acetate and hexane?

The structure of ethyl acetate is CH3COOCH2CH3 - it consists of two carbons bonded together with an oxygen double bonded to one carbon and a single bond to an ethyl group. The structure of hexane is C6H14 - it is a straight-chain hydrocarbon with 6 carbon atoms and 14 hydrogen atoms, all the carbons are single bonded to each other forming a chain.


How do you write structure of 3-ethyl-4-methylhexane?

C-C-C-C-C-C hexane 3rd C gets a CH2CH3 for ethyl 4th C gets a CH3 for methyl


What does ethyl alcohol do to steel?

Ethyl alcohol can corrode or tarnish steel if it is in prolonged contact with the metal, especially in high concentrations. It can also weaken the steel's structure over time.


What is the Iupac name of ethyl acetate?

Ethyl Ethanoate Structurally CH3C(=O)-O-CH2CH3


Is ethyl methyl ketone polar?

Yes, ethyl methyl ketone, also known as methyl ethyl ketone (MEK), is a polar solvent due to the presence of the carbonyl group (C=O) in its structure. This gives the molecule a slight dipole moment, making it polar.


Is ethyl organic or inorganic?

ethyl alcohol is organic