want is respiration?
breathing
Another word for exhale is "expire" or "brethe out"; a synonym for inhale is "inspire" or "breathe in". If you're looking for another word which means both exhaling & inhaling, you could say "breathing" or even "ventilating".
Breathing is the physical act of inhaling and exhaling air, while respiration is the process by which cells obtain energy through the breakdown of glucose in the presence of oxygen. Breathing is a component of respiration, as it helps deliver oxygen to the cells and remove carbon dioxide produced during cellular respiration.
Respiration supplies energy to cells by breakdown of oxygen so is only interacts internally. Breathing is the net movement of gases in and out of the body. The difference is that respiration provides energy for work while breathing provides the reactant for respiration.
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
Internal Respiration: Is changing food (glucose) into energy. External Respiration: Is breathing in and out.
Respiration and breathing are the same thing.
breathing but breathing along with cellular respiration would be called respiration
respiration happens inside the body and breathing happens outside the body
respiration
Repiration and Breathing are not the same process. Respiration is converting glucose to useable energy.
Breathing is one form of respiration.
breathing
Breathing and respiration are related but not the same process. Breathing is the physical act of inhaling and exhaling air, while respiration is the chemical process where cells convert oxygen and nutrients into energy.
Respiration and pulse was taken and documented. Respiration is the act of breathing.
breathing
Breathing is the simple answer. Respiration is also an answer but respiration includes oxygen going into the bloff and throughout the body and Carbon Dioxide going back to the lungs and being exhaled.