0
What else can I help you with?
What is the process called when the carbon dioxide leaves the animal?
breathing
What is Breathing also known as?
Another word for exhale is "expire" or "brethe out"; a synonym for inhale is "inspire" or "breathe in". If you're looking for another word which means both exhaling & inhaling, you could say "breathing" or even "ventilating".
Differentiate breathing from respiration?
Breathing is the physical act of inhaling and exhaling air, while respiration is the process by which cells obtain energy through the breakdown of glucose in the presence of oxygen. Breathing is a component of respiration, as it helps deliver oxygen to the cells and remove carbon dioxide produced during cellular respiration.
How is breathing different from cellular resperation?
Respiration supplies energy to cells by breakdown of oxygen so is only interacts internally. Breathing is the net movement of gases in and out of the body. The difference is that respiration provides energy for work while breathing provides the reactant for respiration.
What is the process of taking in air into your body and giving it out is called?
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
What is the difference from respiration and breathing?
Internal Respiration: Is changing food (glucose) into energy. External Respiration: Is breathing in and out.
What is the relationship between the processes of breathing and cellular respiration?
Respiration and breathing are the same thing.
What is the exchange of air in the body called?
breathing but breathing along with cellular respiration would be called respiration
What is the diffences between respiration and breathing?
respiration happens inside the body and breathing happens outside the body
What describes breathing?
respiration
Is respiration and breathing same process?
Repiration and Breathing are not the same process. Respiration is converting glucose to useable energy.
How do you use respiration in a sentence?
Breathing is one form of respiration.
The term respiration in animals simply refers to what?
breathing
How do use respiration in a sentence?
Respiration and pulse was taken and documented. Respiration is the act of breathing.
What is the process called when the carbon dioxide leaves the animal?
breathing
Are breathing and respiration the same process?
Breathing and respiration are related but not the same process. Breathing is the physical act of inhaling and exhaling air, while respiration is the chemical process where cells convert oxygen and nutrients into energy.
Air moving in and out of lungs is called?
Breathing is the simple answer. Respiration is also an answer but respiration includes oxygen going into the bloff and throughout the body and Carbon Dioxide going back to the lungs and being exhaled.
