0
What else can I help you with?
What two substances make up methane hydrate?
Methane hydrate is a combination of methane (CH4) and water (H2O).
What number would you use to convert moles of CH4 to grams of CH4?
To convert moles of CH4 (methane) to grams, you would use the molar mass of CH4, which is approximately 16.04 g/mol. Multiply the number of moles of CH4 by this molar mass to obtain the mass in grams. The formula is: grams of CH4 = moles of CH4 × 16.04 g/mol.
What are 5 substances found in air?
H2O(Water; particularly vapor), CO2(Carbon dioxide), CH4(Methane), N2O(Nitrous oxide), Particulate Matter, and CFCs(Chlorofluorocarbons)
What is methanes formula?
The chemical formula for methane is CH4.
What does the element ch4 contain?
Ch4 is not an element, it's the compound Methane
Which has greater surface tension of CH4 H2O H2S and Hg?
Among the given substances, Hg (mercury) has the greatest surface tension due to its strong intermolecular forces and cohesive properties. Mercury's atoms are closely packed, which leads to high surface tension compared to methane (CH4), water (H2O), and hydrogen sulfide (H2S).
Are most substances elements?
All substances are MADE FROM elements but they are not elements. For example CH4 is made of one carbon atom and four Hydrogen atoms. Carbon and Hydrogen are pure elements but CH4 is not an element.
What two substances are reacting when a Bunsen Burner is ignited?
The substances of methane (CH4), also known as natural gas, and air (O2) mix to start a Bunsen Burner.
What two substances make up methane hydrate?
Methane hydrate is a combination of methane (CH4) and water (H2O).
What is the name of the substance when you have ch4 plus 2o2 equals co2 plus 2h2o plus heat?
Methane, oxygen, carbon dioxide and water are the four substances.
Is ch4 molecule polar?
No. CH4 is nonpolar.
Is ch4 a Atom or Molecule?
ch4 is an atom.
Two nonpolar substances are most likely?
Two nonpolar substances are most likely to have similar electronegativities and symmetric molecular structures, such as methane (CH4) and carbon tetrachloride (CCl4). These substances have a lack of polar bonds, resulting in no significant difference in electronegativity across their atoms.
Chemical compound has formula ch4?
CH4 = Methane
Why is CH4 an acid?
CH4 is generally not considered an acid.
Which is best fuel in ch4 and c2h6?
It is going to be (CH4) :)
What is the chemical formulae for methane?
Answer 1CH4
