answersLogoWhite

0

Cellular respiration is called an aerobic process because it requires oxygen to efficiently produce energy in the form of ATP. During this process, glucose is broken down in the presence of oxygen, leading to the complete oxidation of substrates and the release of carbon dioxide and water as byproducts. Without oxygen, cells can only rely on anaerobic processes, which produce significantly less ATP. Thus, oxygen is essential for maximizing energy yield during cellular respiration.

User Avatar

AnswerBot

7mo ago

What else can I help you with?

Related Questions

The process that releases chemical energy for use by the cell is called?

The process is called cellular respiration. It involves breaking down glucose molecules to produce ATP (adenosine triphosphate), which is the energy currency of the cell.


What is the process called when the carbon dioxide leaves the animal?

breathing


What is the name of the process that takes place in the alveoli?

respiration ;)


Where do muscles get their energy from?

from the process called respiration.


What is the process of burning something?

This process is called cellular respiration and is an oxidation.


The process by which oxygen and carbon dioxide are exchanged between lungs and the environment is?

The Process of gas exchange is called Respiration


What is the process of respiration that uses oxygen called?

The process of respiration that uses oxygen is called aerobic respiration. During aerobic respiration, cells use oxygen to break down glucose and other nutrients to produce energy in the form of ATP. This process takes place in the mitochondria of cells.


The process by which the cell withdraws energy from glucose is called what?

It is called respiration


What process uses food and oxyegn?

it is called respiration.


What is the process in which a cell takes in oxygen and releases carbon?

This process is called "respiration."


What is the process of taking in air into your body and giving it out is called?

Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O


What is the process by which cells withdraw energy from glucose is called photosynthesis?

It is called respiration