0
Why is the ozone layer comparatively thinner in antarctica than the rest of the world?
There are two reason for the ozone layer to be comparatively thinner in Antarctica than the rest of the world.
1. The polar winds that blow over Antarctica carry the CFCs(Chlorofluorocarbons), that help to break down ozone molecules posing a threat to Earth, to Antarctica.
2. The ice crystals formed above Antarctic in the stratosphere forms a surface for the break down of ozone molecules.
What else can I help you with?
Why is earth becoming thinner due to ozone layer?
Earth is not becoming thinner. The ozone layer is.
Why does the ozone layer dissolve above antarctica?
The ozone layer dissolves above Antarctica. It is because of cold temperature there.
What is the risk of a thinner ozone layer?
A thinner ozone layer might lead to more UV entrance. These UV's might cause cataract like problems in humans.
What chemical caused damage to the ozone layer over Antarctica?
The chemical that cause ozone hole over antarctica is CFC. Chlorofluorocarbons are the ones that contain chlorine which deplete ozone layer.
Why the ozone layer has whole in Antarctica where there is no pollution?
Ozone hole is over Antarctica. It is because ozone depletion requires low temperatures to initiate.
What is earth's thinner layer?
Ozone is the earth's thinner layer. It only contains ozone.
Why is earth becoming thinner due to ozone layer?
Earth is not becoming thinner. The ozone layer is.
Why ozone layer become thinner?
the ozone layer is shrinking because the big hole in it is getting larger so the ozone layer has to be getting smaller so yes
What process that the ozone layer becomes thinner?
Ozone depletion makes it thinner. It is because of CFC's.
What does the ozone layer have to do with antarctica?
Ozone is depleted at Antarctica. It is because of low temperatures.
Why does the ozone layer dissolve above antarctica?
The ozone layer dissolves above Antarctica. It is because of cold temperature there.
What penetrates the atmosphere when the ozone layer gets thinner?
When the ozone layer gets thinner, its power becomes low. It causes the UV to penetrate it.
Why is the ozone layer depleted in Antarctica?
The ozone depletion requires low temperatures. It is because ozone is depleted in Antarctica.
Is the ozone layer destroying Antarctica?
No
Where is the hole in the ozone layer located?
The hole in the ozone layer is located over Antarctica.
What is a possible side effect of a thinner ozone layer?
Thinner ozone layer allows the Uv rays to pass though. These are high energy fatal rays.
What happens a the ozone layer becomes thinner?
When the ozone layer becomes thinner then the harmful UV rays will enter the surface of the earth. These radiations are fatal for life on earth.
