answersLogoWhite

0

Nickel is a chemical metal element. There are 28 electrons in a single atom.

User Avatar

Wiki User

10y ago

What else can I help you with?

Related Questions

How many electrons has an atom of iron lost to become an Fe3 plus ion?

it should lose 3 electrons


When this equation is balanced what is the coefficient for ni(no3)3. ni(no3)3 plus pbbr4 -- and gt nibr3 plus pb(no3)4?

Your formulas are not correct.


What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?

NI(NO3)3+pbbr4nibr3+pb(no3)4


How many electrons are in the outer shell of aluminium?

3 electrons total. electrons is the number on the top right corner with the plus sign indicating that electrons are positive.


How many electrons are gained when going from Al to Al3 plus?

-3 electrons are gained,i.e,3 electrons are lost by Al and 3 electrons are gained by the other atom nearby.


How many protons and electrons are in Li plus 1?

In Li plus 1, the element is lithium (Li) which has 3 protons. Since it has a +1 charge, it means it has lost one electron, so it has 2 electrons.


How many protrons and electrons are in Li plus 1?

There are 3 protons and 2 electrons present in a lithium ion.


How many protons neutrons and electrons in Ce3 plus?

The ion Ce(3+) of the isotope Ce-140 has 58 protons, 82 neutrons and 55 electrons.


Fe plus Ni(OH)2-- and gt Ni plus Fe(OH)3 What if your answer?

The reaction Fe + Ni(OH)₂ → Ni + Fe(OH)₃ is an example of a redox reaction where iron (Fe) is oxidized, and nickel hydroxide (Ni(OH)₂) is reduced. In this process, iron donates electrons, leading to the formation of iron(III) hydroxide (Fe(OH)₃), while nickel is reduced to its elemental form. This indicates that iron has a higher tendency to oxidize compared to nickel in this context. Overall, the reaction showcases the principles of electron transfer and the relative reactivity of the metals involved.


What is 80 electrons in each plus 3 cation?

This describes an ionic compound with an 8:3 ratio of electrons to cations. The cation has a charge of +3, meaning it has lost 3 electrons. The total number of electrons in the compound is 80.


Why is aluminum plus 3?

Because there are 3 electrons in its outermost shell, to reach the nearest noble gas electronic configuration it loses 3 electrons .


How many electrons does the neutral atom gain or lose when Cr3 plus forms?

When Cr3+ forms, the neutral atom (chromium) loses 3 electrons. This happens because the neutral chromium atom has 24 electrons, but when it forms Cr3+, it loses 3 electrons to have a total of 21 electrons.