0
What else can I help you with?
What is subdominant triad of B major?
There is no such thing as B major. There is B minor and B flat major. The subdominant triad of B minor ( I'm pretty sure) is E minor.
What are five trigonometric identities?
All others can be derived from these and a little calculus: sin2x+cos2x=1 sec2x-tan2x=1 sin(a+b)=sin(a)cos(b)+sin(b)sin(a) cos(a+b)=cos(a)cos(b)-sin(a)sin(b) eix=cos(x)+i*sin(x)
What is tan20tan32 plus tan32tan38 plus tan38tan20?
This may not be the most efficient method but ... Let the three angle be A, B and C. Then note that A + B + C = 20+32+38 = 90 so that C = 90-A+B. Therefore, sin(C) = sin[(90-(A+B) = cos(A+B) and cos(C) = cos[(90-(A+B) = sin(A+B). So that tan(C) = sin(C)/cos(C) = cos(A+B) / sin(A+B) = cot(A+B) Now, tan(A+B) = [tan(A)+tan(B)] / [1- tan(A)*tan(B)] so cot(A+B) = [1- tan(A)*tan(B)] / [tan(A)+tan(B)] The given expressin is tan(A)*tan(B) + tan(B)*tan(C) + tan(C)*tan(A) = tan(A)*tan(B) + [tan(B) + tan(A)]*cot(A+B) substituting for cot(A+B) gives = tan(A)*tan(B) + [tan(B) + tan(A)]*[1- tan(A)*tan(B)]/[tan(A)+tan(B)] cancelling [tan(B) + tan(A)] and [tan(A) + tan(B)], which are equal, in the second expression. = tan(A)*tan(B) + [1- tan(A)*tan(B)] = 1
In a triangle ABC b equals 15 cm and c equals 25 cm and also angle B equals 32'15'Find the side a and other angles?
By the sine rule, sin(C)/c = sin(B)/b so sin(C) = 25/15*sin(32d15m) = 0.8894 so C = 62.8 deg or 117.2 deg. Therefore, A = 180 - (B+C) = 85.0 deg or 30.5 deg and then, using the sine rule again, a/sin(A) = b/sin(B) so a = sin(A)*b/sin(B) = 28 or a = 14.3
What is the square root of Pythagoras?
Pythagoras was a Classical Greek mathemtician. He gave us the equation. h^(2) = a^(2)+ b^(2) To take the 'square root (sqrt) of this equation we write. sqrt[h^(2)] = sqrt[ a^(2) + b^(2) ] or h = sqrt[a^(2) + b^(2)] Note the use of square brackets to indicate on the RHS that the sum of the squared numbered is square rooted.; NOT the individual numbers. The Pyrthagorean Eq'n refers to Right-Angles triangles. 'h' is the hypotenuse ; the angle opposite the right angle. 'a' & 'b' are the two sides that make up the right angle.
What is stronger Plan B Franchise or the pro lite?
Plan b all day
If you took plan b can you take medicine like cold medicine or laxitives the next day?
Yes you can take cold medicine.
What do you do if you take two pills one day and are off one day the rest of the month?
When this happens you need to take Plan B if you have unprotected intercourse. You also need to use a condom for 4 weeks.
When is obama b day?
August the 4th.
How long do you have to take plan b?
72 hours
When is Obama's B-day?
August 4th 1961
How long does plan b stay in your blood?
The half-life of plan B is a couple of days. It will not provide protection, though, for sex you have after you take it.
When is tom Parkers b-day?
August 4th. xx
Can I take plan b with NyQuil and amoxicillin?
Yes, you can generally take Plan B (levonorgestrel) with NyQuil and amoxicillin. There are no known interactions between Plan B and these medications. However, if you have specific health concerns or are on other medications, it's always best to consult with a healthcare professional for personalized advice.
Can you take Excedrin Tylenol or Aleve after taking Plan B and if so how long would you have to wait?
Yes, there are no known drug interactions between Aleve and Plan B.
When is Austin mahones b day?
His Birthday Is 4th April 1996:)
What is j3t from Hollywood undead's birthday?
his b-day is June 4th
