0
What else can I help you with?
What is subdominant triad of B major?
There is no such thing as B major. There is B minor and B flat major. The subdominant triad of B minor ( I'm pretty sure) is E minor.
What are five trigonometric identities?
All others can be derived from these and a little calculus: sin2x+cos2x=1 sec2x-tan2x=1 sin(a+b)=sin(a)cos(b)+sin(b)sin(a) cos(a+b)=cos(a)cos(b)-sin(a)sin(b) eix=cos(x)+i*sin(x)
What is tan20tan32 plus tan32tan38 plus tan38tan20?
Oh honey, you're throwing some trigonometry at me? Alright, buckle up. The sum of tan20tan32 plus tan32tan38 plus tan38tan20 is equal to 1. Just plug in those values and watch the magic happen. Math can be sassy too, you know.
In a triangle ABC b equals 15 cm and c equals 25 cm and also angle B equals 32'15'Find the side a and other angles?
By the sine rule, sin(C)/c = sin(B)/b so sin(C) = 25/15*sin(32d15m) = 0.8894 so C = 62.8 deg or 117.2 deg. Therefore, A = 180 - (B+C) = 85.0 deg or 30.5 deg and then, using the sine rule again, a/sin(A) = b/sin(B) so a = sin(A)*b/sin(B) = 28 or a = 14.3
What is y equals m x plus b?
Y=mx+b is the equation of a straight line graph in mathematics. Answer Y = mX + b This is the general form of an Equation for a Straight Line when plotted on a coordinates of X versus Y. where. m = slope of the line b = intercept point of the Y-Axis (or the value of Y when X=0)
What is stronger Plan B Franchise or the pro lite?
Plan b all day
If you took plan b can you take medicine like cold medicine or laxitives the next day?
Yes you can take cold medicine.
When is obama b day?
August the 4th.
What do you do if you take two pills one day and are off one day the rest of the month?
When this happens you need to take Plan B if you have unprotected intercourse. You also need to use a condom for 4 weeks.
How long do you have to take plan b?
72 hours
When is Obama's B-day?
August 4th 1961
How long does plan b stay in your blood?
The half-life of plan B is a couple of days. It will not provide protection, though, for sex you have after you take it.
When is tom Parkers b-day?
August 4th. xx
Can you take Excedrin Tylenol or Aleve after taking Plan B and if so how long would you have to wait?
Yes, there are no known drug interactions between Aleve and Plan B.
When is Austin mahones b day?
His Birthday Is 4th April 1996:)
What is j3t from Hollywood undead's birthday?
his b-day is June 4th
Were to have your 12th b day?
Take them on a holiday
