There is no such thing as B major. There is B minor and B flat major. The subdominant triad of B minor ( I'm pretty sure) is E minor.
All others can be derived from these and a little calculus: sin2x+cos2x=1 sec2x-tan2x=1 sin(a+b)=sin(a)cos(b)+sin(b)sin(a) cos(a+b)=cos(a)cos(b)-sin(a)sin(b) eix=cos(x)+i*sin(x)
Oh honey, you're throwing some trigonometry at me? Alright, buckle up. The sum of tan20tan32 plus tan32tan38 plus tan38tan20 is equal to 1. Just plug in those values and watch the magic happen. Math can be sassy too, you know.
By the sine rule, sin(C)/c = sin(B)/b so sin(C) = 25/15*sin(32d15m) = 0.8894 so C = 62.8 deg or 117.2 deg. Therefore, A = 180 - (B+C) = 85.0 deg or 30.5 deg and then, using the sine rule again, a/sin(A) = b/sin(B) so a = sin(A)*b/sin(B) = 28 or a = 14.3
Y=mx+b is the equation of a straight line graph in mathematics. Answer Y = mX + b This is the general form of an Equation for a Straight Line when plotted on a coordinates of X versus Y. where. m = slope of the line b = intercept point of the Y-Axis (or the value of Y when X=0)
Plan b all day
Yes you can take cold medicine.
August the 4th.
When this happens you need to take Plan B if you have unprotected intercourse. You also need to use a condom for 4 weeks.
72 hours
August 4th 1961
The half-life of plan B is a couple of days. It will not provide protection, though, for sex you have after you take it.
August 4th. xx
Yes, there are no known drug interactions between Aleve and Plan B.
His Birthday Is 4th April 1996:)
his b-day is June 4th
Take them on a holiday