Plan B, or emergency contraception, is most effective when taken as soon as possible after unprotected intercourse, ideally within 72 hours. However, it can still be taken up to 5 days after the event, though its effectiveness decreases over time. Taking it on the fourth day is possible, but it may not be as effective as taking it sooner. Always consult a healthcare provider for personalized advice.
There is no such thing as B major. There is B minor and B flat major. The subdominant triad of B minor ( I'm pretty sure) is E minor.
All others can be derived from these and a little calculus: sin2x+cos2x=1 sec2x-tan2x=1 sin(a+b)=sin(a)cos(b)+sin(b)sin(a) cos(a+b)=cos(a)cos(b)-sin(a)sin(b) eix=cos(x)+i*sin(x)
This may not be the most efficient method but ... Let the three angle be A, B and C. Then note that A + B + C = 20+32+38 = 90 so that C = 90-A+B. Therefore, sin(C) = sin[(90-(A+B) = cos(A+B) and cos(C) = cos[(90-(A+B) = sin(A+B). So that tan(C) = sin(C)/cos(C) = cos(A+B) / sin(A+B) = cot(A+B) Now, tan(A+B) = [tan(A)+tan(B)] / [1- tan(A)*tan(B)] so cot(A+B) = [1- tan(A)*tan(B)] / [tan(A)+tan(B)] The given expressin is tan(A)*tan(B) + tan(B)*tan(C) + tan(C)*tan(A) = tan(A)*tan(B) + [tan(B) + tan(A)]*cot(A+B) substituting for cot(A+B) gives = tan(A)*tan(B) + [tan(B) + tan(A)]*[1- tan(A)*tan(B)]/[tan(A)+tan(B)] cancelling [tan(B) + tan(A)] and [tan(A) + tan(B)], which are equal, in the second expression. = tan(A)*tan(B) + [1- tan(A)*tan(B)] = 1
By the sine rule, sin(C)/c = sin(B)/b so sin(C) = 25/15*sin(32d15m) = 0.8894 so C = 62.8 deg or 117.2 deg. Therefore, A = 180 - (B+C) = 85.0 deg or 30.5 deg and then, using the sine rule again, a/sin(A) = b/sin(B) so a = sin(A)*b/sin(B) = 28 or a = 14.3
Pythagoras was a Classical Greek mathemtician. He gave us the equation. h^(2) = a^(2)+ b^(2) To take the 'square root (sqrt) of this equation we write. sqrt[h^(2)] = sqrt[ a^(2) + b^(2) ] or h = sqrt[a^(2) + b^(2)] Note the use of square brackets to indicate on the RHS that the sum of the squared numbered is square rooted.; NOT the individual numbers. The Pyrthagorean Eq'n refers to Right-Angles triangles. 'h' is the hypotenuse ; the angle opposite the right angle. 'a' & 'b' are the two sides that make up the right angle.
Plan b all day
Yes you can take cold medicine.
When this happens you need to take Plan B if you have unprotected intercourse. You also need to use a condom for 4 weeks.
August the 4th.
72 hours
August 4th 1961
The half-life of plan B is a couple of days. It will not provide protection, though, for sex you have after you take it.
August 4th. xx
Yes, you can generally take Plan B (levonorgestrel) with NyQuil and amoxicillin. There are no known interactions between Plan B and these medications. However, if you have specific health concerns or are on other medications, it's always best to consult with a healthcare professional for personalized advice.
Yes, there are no known drug interactions between Aleve and Plan B.
his b-day is June 4th
His Birthday Is 4th April 1996:)