0
What else can I help you with?
What notes are in a G major triad?
A G major triad consists of three notes: G, B, and D. The G note is the root, B is the major third, and D is the perfect fifth. Together, these notes create the harmonious sound characteristic of a G major chord.
What is the 3 notes in a g major triad?
A G major triad consists of three notes: G, B, and D. The root note is G, the major third is B, and the perfect fifth is D. Together, these notes create the harmonious sound characteristic of the G major chord.
What is tan20tan32 plus tan32tan38 plus tan38tan20?
This may not be the most efficient method but ... Let the three angle be A, B and C. Then note that A + B + C = 20+32+38 = 90 so that C = 90-A+B. Therefore, sin(C) = sin[(90-(A+B) = cos(A+B) and cos(C) = cos[(90-(A+B) = sin(A+B). So that tan(C) = sin(C)/cos(C) = cos(A+B) / sin(A+B) = cot(A+B) Now, tan(A+B) = [tan(A)+tan(B)] / [1- tan(A)*tan(B)] so cot(A+B) = [1- tan(A)*tan(B)] / [tan(A)+tan(B)] The given expressin is tan(A)*tan(B) + tan(B)*tan(C) + tan(C)*tan(A) = tan(A)*tan(B) + [tan(B) + tan(A)]*cot(A+B) substituting for cot(A+B) gives = tan(A)*tan(B) + [tan(B) + tan(A)]*[1- tan(A)*tan(B)]/[tan(A)+tan(B)] cancelling [tan(B) + tan(A)] and [tan(A) + tan(B)], which are equal, in the second expression. = tan(A)*tan(B) + [1- tan(A)*tan(B)] = 1
What is subdominant triad of B major?
There is no such thing as B major. There is B minor and B flat major. The subdominant triad of B minor ( I'm pretty sure) is E minor.
What are five trigonometric identities?
All others can be derived from these and a little calculus: sin2x+cos2x=1 sec2x-tan2x=1 sin(a+b)=sin(a)cos(b)+sin(b)sin(a) cos(a+b)=cos(a)cos(b)-sin(a)sin(b) eix=cos(x)+i*sin(x)
How long does plan b stay in your blood?
The half-life of plan B is a couple of days. It will not provide protection, though, for sex you have after you take it.
What is the best way to avoid pregnancy after three days of a delayed?
well plan-b,would help but only one to the beginning of three days if you r birth control didint work:))
What medicine should you take to stop pregnancy?
If it is within 5 days after having sex, you can take the morning after pill, also called plan B. Otherwise you have to see a doctor for an abortion.
How long do you have to take plan b?
72 hours
If you take Plan B but are on the nuva ring what should you do?
Continue to use NuvaRing on schedule, according to your calendar, without any regard to bleeding. When ten days have passed since the accident, take a pregnancy test.
Can I take plan b with NyQuil and amoxicillin?
Yes, you can generally take Plan B (levonorgestrel) with NyQuil and amoxicillin. There are no known interactions between Plan B and these medications. However, if you have specific health concerns or are on other medications, it's always best to consult with a healthcare professional for personalized advice.
Can you take Excedrin Tylenol or Aleve after taking Plan B and if so how long would you have to wait?
Yes, there are no known drug interactions between Aleve and Plan B.
After taking Plan B it is normal to have spotting after ones menstrual cycle for days at a time?
After taking Plan B it is normal to have spotting after one's menstrual cycle for days at a time, if you just started taking the pill. However, if you have been on Plan B for a while, this type of bleeding may not be normal. It could be that the uterus did not expel all of the blood during your period and so spotting occurs mid-cycle.
Mortgage broker contract should be executed within how many days?
b. three business days of application.
A finishes the work in 10 days and B in 8 days individually If A works for only 6 days then how many days should B work to complete A's work?
In one day A does 10% of the work and B does 12½%, so after A's 6 days he has done 60%, leaving 40% for B who will need three-and-a-fifth days to complete the work.
What Are Plan B's Best Songs?
well plan b is an amazing singer and rapper! so i would probally say his top 10 were in my opinion and not in popularity are... 1)plan b and chase staus end credits 2)plan b staying too long 3)plan b charmaine 4)plan b she said 5)plan b the recluse 6)plan b mama 7)plan b i know a song 8)plan b hard times 9)plan b writings on the wall 10)tough love
Could you be pregnant or did plan b mess up your period?
It could be both. 2 weeks after taking Plan B you always have to take a pregnancy test. Or you need to see a doctor.
