0
There are two types and many other isomers of C20H42
(wikipedia citation "It has 366,319"; all of them have different physical properties)
1.
n-Icosane (alternative spelling eicosane) Density of the UNbranched n-icosane: 932 mg mL−1 (at 20 °C)
Molecular formula CH3(CH2)18CH3
2. IUPAC name: 2,6,10,14-Tetramethylhexadecane. Density 791 mg mL−1 (at 20 °C).
Molecular formula: CH3CH(CH3)CH2CH2-(CH2CH(CH3)CH2CH2)-(CH2CH(CH3)CH2CH2)-CH2CH(CH3)CH2CH3
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
How many mm are in 452 in?
452 inches equals 11480.8mm
What does 452' equal in meters and centimeters?
452 feet is 137 meters and 76.96 centimeters.
How many feet are there in 452 meters?
There are 0.3048 metres in one foot. Therefore, rounded to two decimal places, 452 metres is equal to 452/0.3048 = 1482.94 feet. Direct Conversion Formula 452 m* 1 ft 0.3048 m = 1,482.939633 ft
What were some effects of hurricane charlie?
o.452+13
How much is 12 to 16 ounces in grams?
338 - 452 grams
What is telephone number for edward catterton in fitchburg mass?
Eddiecatug 555-452-2884
What is 2 percent of 452?
2 percent of 452 is 9.04. .02 * 452 = 9.04.
What the time quarter to three?
2:452:452:452:45
What is 452 400?
452+400=852
What is 2712 divided by 6?
452
What is 452 as a decimal?
452, exactly as in the question.
What is 452 percent as a fraction?
452/1000
What percentage is 7 of 452?
Seven is 1.55% of 452.
What is 452 -197?
649
What is the roman number for 452?
CDLII = 452.
What is 905 - 453?
452
Is 452 a prime number?
452 is a composite number
