0
What else can I help you with?
Related Questions
Is a volcano erupting luminous or non luminous?
It is luminous
How many pepople are killed by erupting volcanoes?
there are about 1,000,000 people killed by erupting volcanoes or more!!! hi what your name!!!!$$$5%%%%####
When active volcanoes cease erupting and cool off they become?
dormant volcanoes. These volcanoes are not currently erupting but have the potential to become active again in the future.
Why do erupting volcanoes never seen?
I no understand?:/
What materials are thrown by erupting volcanoes?
ashgasessmokemagma
Are most volcanoes dangerous?
If it erupting then yes.
What are the effects of volcanoes erupting in Hawaii?
death
What is another word for active volcanoes?
erupting
Are volcanoes volcanoes before they erupt?
Yes they are. A volcano that is not erupting is called a dormant (meaning sleeping) volcano, while one that is erupting is called an active volcano.
How does exploding volcanoes relate to volcanoes?
there the same think but the only diffrence is that the volcano is erupting
What is the active volcano's origin?
active volcanoes are not erupting
What is formed by erupting volcanoes?
Cinder cone volcano
Trending Questions
Is sandara park one of the Wonder Girls?
What musical instrument originated in France?
What is the middle of a mountain?
What is the highest priority substituent in CH3CH2CH2-CH2CH(CH3)2-CC-CH2CH2Br- CH2Cl?
Do south Americans speak English?
How does cholesterol affect the plasma membrane at low temperatures?
What is string in Python?
How do you get rid of little flies that look like fruit flies but there not?
Where can you find an example of a professional organizer business plan?
Prime factorization of 51?
What grocery store in Cleveland OH sells Boar's Head Turkey?
Mother left her property to her husband and children. He remarried and has died. Who owns the real estate now?
Voltaire believed there is only evil in the world or are there redeeming Qualities to the characters in Candide?
What is scientific name of paddy?
Is gears of war 3 in a ps3?
What is worse a MISDEMEANOR 1 OR MISDEMEANOR 4?
How does natural selection affect the competition between two organisms?
Why do scientist group animals and plants?
Where can you spend money that is in pence?
Can the thermometer be kept on other places than mouth to get the body temperature?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.