0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the difference between salt and msg?
The difference between salt and msg is that salt is a natural occurring mineral substance and is needed by the human body. MSG is an artificial chemical that causes problems in the nervous system and brain.
What is the difference between the o2 arena and msg?
to shuvvv it up ur
How can send IM in a network using command prompt?
"msg" command might help. It pops up a message box on the users PC. C:/> msg <user_name> "Hello" "msg" command might help. It pops up a message box on the users PC. C:/> msg <user_name> "Hello"
what is the chemical formula for-monosodium glutamate?
MSG, 2-aminopentanedioic acid, is C5H8NNaO4 and has a SMILES (simplified molecular input line entry specification) of C(CC(=O)O)C(C(=O)O-)N.[Na+]. A link is provided to the Wikipedia article on MSG.
What others channel's are there on the rogers box that are NBA tv or NBA league pass?
there is tnt,espn,espn2,abc,and msg
Does pastrami have MSG?
Is there MSG in pastrami
Why compiler doesn't support space in between character array?
int main (void) { char msg [] = "You are wrong here, spaces are perfectly okay"; puts (msg); return 0; }
Does most coffee have msg?
Coffee does NOT have MSG.
Is there msg in ritz crackers?
There's no "monosodium glutamate" listed on the ingredients label on this box before my eyes, so I'd say no--but MSG can be labeled as SEVERAL different things, including "natural flavors," which is the last ingredient listed on the Ritz box. So... until somebody actually hears a direct "no" from Ritz, I'd say yes!
What is an Alert in JavaScript?
A JavaScript Alert, called by using the alert(msg); function, creates a dialog window in front of the browser that displays some sort of message (msg) and an OK button. The user much click the OK button in order to do anything else on that page.Additional:alert("Hello World!"); //simply an alert msg with ok buttonconfirm("Are you sure you want to quit?"); // it is a confirmation box with ok and cancel buttonprompt("Enter Your name."); //this one will let you enter something in a box.
What does MSG contain?
MSG stands for monosodium glutamate.
What does MSG mean in airsoft?
MSG has not significance in airsoft.
