0
Omega-3 fatty acids are a family of n-3 fatty acids and therefore not a drug or chemical. There is no more specific a name for this group of fatty acids than omega-3.
Three fatty acids in this group that are of nutritional significance in the human diet are: α-linolenic acid (ALA), eicosapentaenoic acid (EPA) and docosahexaenoic acid (DHA).
Wiki User
∙ 14y ago
Add your answer:
Earn +20 pts
Is a fatty acid inorganic?
NO!!!! 'Fatty Acid' is the archaic name for carboxylic acids. e.g. Formic Acid now Methanoic acid, and Acetic Acid now Ethanoic acid.
Are trans fatty acid routinely made by the human body?
Trans fat is the common name for unsaturatedfatwith transisomer fatty acid.
What is the common name of a fatty acid that has c18 2n3 structure?
Alpha Linoleic acid
What are triglycerides and what kind of fatty acid is this?
Triglycerides are a type of fatty acid that aid in the bodily processes of the liver. They are composed of one glycerol and three fatty acids, hence the name, tri-glycerides.
What is the regular name for acid?
The drug acid is also called LSD (Lysergic acid diethylamide)
What name is given to glycerol plus fatty acid-monoglyceride plus water?
Glycerol plus Fatty acid-monoglyceride plus water forms through condensation reaction a Triglyceride
How do you determine the phospholipid composition of a lecithin?
Lecithin is a another name for phosphatidyl choline. Hydrolysis to remove the fatty acid chains from the choline followed by HPLC can determine which fatty acid chains are attached.
What is the name of the acid in fish?
Fish oil contains two Omega 3 fatty acids called Docoashexaenoic and eicosapentaenoic acid
Name three saturated and three unsaturated fatty acids?
Fatty Acids are the name we use to give Carboxylic Acids with long hydrocarbon chains.These hydrocarbon chains can contain one or more double bonds, which we can refer to the Fatty Acid as being unsaturated.Saturated fatty acids are simple long chains.Some Examples:SaturatedStearic Acid - CH3(CH2)16COOHLauric Acid - CH3(CH2)10COOHArachidic Acid - CH3(CH2)18COOHUnsaturatedOleic Acid - CH3(CH2)7CH=CH(CH2)7COOHErucic Acid - CH3(CH2)7CH=CH(CH2)11COOHPalmitoleic Acid - CH3(CH2)5CH=CH(CH2)7COOH
Generic drug name of Bayer aspirin?
The generic name is Aspirin or acetylsalicylic acid.
What is the trade name for the pain-killing drug acetylsalicylic acid?
Aspirin.
Why are they called omega-3 fatty acids?
The name "Omega-3" indicates that the first double bond occurs on the third carbon atom from the end of the molecule or last position (i.e. the omega position, the last letter in Greek alphabet)To find the place of the double bond, you would count to the third carbon atom from the 'end' carbon atom of the alkenoic acid (the unsaturated fatty acid). More complex unsaturated acid names would include, for example,Omega-3,6,9-Octadecatrienoic acid (linolenic acid)(see related link to a structural formula diagram of omega or alpha numbering of unsaturated fatty acids)
