0
Equation of saponification using oleopalmitostearin as triglyceride?
Wiki User
∙ 11y ago
CH2OCO(CH2)7CH=CH(CH2)7CH3 CH2OH CH3(CH2)7CH=CH(CH2)7COONa
| | +
CHOCO(CH12)12CH3 + 3NaOH ---> CHOH + CH3(CH2)14COONa
| | +
CH2OCO(CH2)16CH3 CH2OH CH3(CH2)16COONa
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
What is the reaction of saponification by using ordinary fat?
Soaps make soluble in water fats an oils, forming specific micelles.
What is the degree of saponification?
Saponification is the process of creating soap. It typically involves reacting a strong alkaline (such as sodium hydroxide, potassium hydroxide, etc.) with a fatty acid or oil. The strong base reacts with the fatty acid to create a salt with a long hydrocarbon chain left over from the fatty acid or oil. Here's the reaction (using lye as an example): (hydrocarbon chain)-COOH + NaOH --> (hydrocarbon chain)-COONa + H2O When the cation bonds with the fatty acid/oil, it creates a new substance that possess the hydrophilic properties of the lipid hydrocarbon chain as well as the hydrophilic properties of the alkali metal (the sodium atom). Therefore, it can mix with both hydrophobic AND hydrophilic substances. Thus, if you need to wash away something greasy (hydrophobic), the hydrophobic chain of the soap will mix with the greasy substance, and a polar substance (such as water) can mix with the hydrophilic end of the soap as well...allowing you to mix grease with soap with water...and wash it away.
What is the equation for photosynthesis using CO2 and H2S?
It is not using H2S gas. It is using H2O liquid.
What is the equation using cellular respiration?
6C6H12O6 + 6O2 --> 6CO2 + 6H2O + 34ATP The equation shown above is the chemical equation of aerobic cellular respiration. It takes in a complex sugar, glucose, and breaks it down in order to harvest its stored up energy.
Moment of inertia of a sphere How do you prove it using calculus As in deriving the equation using density and mass density being uniform?
The simple scalar method of calculation is to integrate the square of the radius (r) across dm, where m is the mass. (Integral r2 dm is the equation, but we don't have an integral sign here.) Use the link to Wikipedia for the rest of the information and expansions on the "basic" equation.
What is the formula to calculate saponification number?
Insoluble soaps are not likely to exist, they won't work when not IN water. For more you can trust on this: his process is called saponification: fat + sodium hydroxide -> Sodium salts of fatty acid (Soap) + glycerol
What is the reaction of saponification by using ordinary fat?
Soaps make soluble in water fats an oils, forming specific micelles.
How can you represent a proportional relationship using an equation?
You cannot represent a proportional relationship using an equation.
What is equadtratic equation?
A quadratic equation normally has 2 solutions and can be solved by using the quadratic equation formula.
How do you solve for x using a quadratic equation?
For an equation of the form ax² + bx + c = 0 you can find the values of x that will satisfy the equation using the quadratic equation: x = [-b ± √(b² - 4ac)]/2a
Derivation of gibbs-duhem-margules equation using gibbs-duhem equation?
Gibbs-duhem-margules equation and its derivation
What is the degree of saponification?
Saponification is the process of creating soap. It typically involves reacting a strong alkaline (such as sodium hydroxide, potassium hydroxide, etc.) with a fatty acid or oil. The strong base reacts with the fatty acid to create a salt with a long hydrocarbon chain left over from the fatty acid or oil. Here's the reaction (using lye as an example): (hydrocarbon chain)-COOH + NaOH --> (hydrocarbon chain)-COONa + H2O When the cation bonds with the fatty acid/oil, it creates a new substance that possess the hydrophilic properties of the lipid hydrocarbon chain as well as the hydrophilic properties of the alkali metal (the sodium atom). Therefore, it can mix with both hydrophobic AND hydrophilic substances. Thus, if you need to wash away something greasy (hydrophobic), the hydrophobic chain of the soap will mix with the greasy substance, and a polar substance (such as water) can mix with the hydrophilic end of the soap as well...allowing you to mix grease with soap with water...and wash it away.
How can you find a variable in math?
You find, or construct, an equation or set of equations which express the unknown variable in terms of other variables. Then you solve the equation(s), using algebra.You find, or construct, an equation or set of equations which express the unknown variable in terms of other variables. Then you solve the equation(s), using algebra.You find, or construct, an equation or set of equations which express the unknown variable in terms of other variables. Then you solve the equation(s), using algebra.You find, or construct, an equation or set of equations which express the unknown variable in terms of other variables. Then you solve the equation(s), using algebra.
What is the equation for photosynthesis using CO2 and H2S?
It is not using H2S gas. It is using H2O liquid.
The chemical reaction between two or more substances is described using what equation?
A chemical equation.
What is a reactant equation using Tantalum?
It burns to give T2O5 - that should be an easy equation to write.....
What should you do when using diatomic elements in an equation?
Nothing special, please balance correctly the equation.
