0
H_ ..... _H
H_C=C_H
In C2H4 (ethane, ethene, ethylene) there is a double carbon bond between CH2 structures.
Wiki User
∙ 13y ago
The structural formula for ethyl butyrate is CH3CH2CH2COOCH2CH3. It is an ester formed from butyric acid and ethanol, commonly used as a flavoring agent due to its fruity aroma reminiscent of pineapples.
Wiki User
∙ 15y agoit is ch3-ch2-ch2-coo-ch2-ch3 but one of the oxygen has a double bond
Wiki User
∙ 13y agoStructural :
CH3COOCH2CH3
Add your answer:
Earn +20 pts
Combustion of 2.22 mg of ethyl butyrate produces 5.06 mg of CO2 and 2.06 mg of H20 what is the empirical formula?
To find the empirical formula, you need to determine the moles of each element present in the given compounds. Convert the given masses of CO2 and H2O to moles, then calculate the moles of C, H, and O in ethyl butyrate. Finally, find the simplest whole-number ratio of these moles to determine the empirical formula, which in this case is C5H10O2.
What is ethyl butyrate?
It is the ester of ethanol (C2H5OH) and butyric acid (butanoic acid, (HO-)(O=)C-C3H7 ) formula: (C2H5O-)(O=)C-C3H7
What is the structural formula of 2-ethyl hexane?
The structural formula of 2-ethyl hexane is CH3(CH2)3CH(CH3)CH2CH3. It consists of an ethyl group (C2H5) attached to the second carbon atom of a hexane chain.
What is the common name for MethylButanoate?
The common name for MethylButanoate is ethyl butyrate.
What what is the structural formula for CH3CH2COCH3?
The structural formula for CH3CH2COCH3, also known as acetone, is CH3-CO-CH2-CH3. It consists of a central carbon atom with a ketone group (C=O) attached to two methyl (CH3) groups on either side.
The characteristic odor of pineapple is due to ethyl butyrate a compound of 2.78mg ethyl butyrate produces 6.32mg of CO2 and 2.58mg of H2O what is the empirical formula of the compound?
C3H6O the 3 and 6 are subscripts
What is the structural formula for ethyl alcohol?
Ethyl alcohol - ethanol - is a pure alcohol that is volatile and flammable. It has the structural formula of C2H6O.
Combustion of 2.22 mg of ethyl butyrate produces 5.06 mg of CO2 and 2.06 mg of H20 what is the empirical formula?
To find the empirical formula, you need to determine the moles of each element present in the given compounds. Convert the given masses of CO2 and H2O to moles, then calculate the moles of C, H, and O in ethyl butyrate. Finally, find the simplest whole-number ratio of these moles to determine the empirical formula, which in this case is C5H10O2.
What functional group is in ethyl butyrate?
ester
Chemical formula for ethyl acetate?
Molecular formula is C2H5CH3COO . Structural formula is CH3COOCH2CH3 .
What what is the structural formula for CH3CH2COCH3?
The structural formula for CH3CH2COCH3, also known as acetone, is CH3-CO-CH2-CH3. It consists of a central carbon atom with a ketone group (C=O) attached to two methyl (CH3) groups on either side.
What is ethyl butyrate?
It is the ester of ethanol (C2H5OH) and butyric acid (butanoic acid, (HO-)(O=)C-C3H7 ) formula: (C2H5O-)(O=)C-C3H7
What is the structural formula chemical equation for ethyl ethanoate plus water?
CH3CH2OOCCH3 + H2O ===> CH3CH2OH + CH3COOH
What is the formula for butanone?
Butanone is the IUPAC name for methyl ethyl ketone (MEK). Empirical: C4H8O. Structural: CH3COCH2CH3.
What is the structural formula of 2-ethyl hexane?
The structural formula of 2-ethyl hexane is CH3(CH2)3CH(CH3)CH2CH3. It consists of an ethyl group (C2H5) attached to the second carbon atom of a hexane chain.
What is boiling point of butyl acetate?
Boiling point of ethyl butyrate: + 121 °C.
What is the condensed structural formula for 3 ethyl 2 5 dimethyloctane?
Ch3ch(ch3)ch(ch2ch3)ch2ch(ch3)ch2ch2ch3
