0
H_ ..... _H
H_C=C_H
In C2H4 (ethane, ethene, ethylene) there is a double carbon bond between CH2 structures.
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
Combustion of 2.22 mg of ethyl butyrate produces 5.06 mg of CO2 and 2.06 mg of H20 what is the empirical formula?
The chemical formula of ethyl butirate is C6H12O2.
What what is the structural formula for CH3CH2COCH3?
That IS the structural formula. The compound is called either 2-butanone or methyl ethyl ketone.
What is ethyl butyrate?
It is the ester of ethanol (C2H5OH) and butyric acid (butanoic acid, (HO-)(O=)C-C3H7 ) formula: (C2H5O-)(O=)C-C3H7
What is the structural formula of 2-ethyl hexane?
CH3-CH=CH2-CH2-CH2-CH3 CH3
How do you draw the chemical formula for ethyl acetate?
ch3cooc2h5
The characteristic odor of pineapple is due to ethyl butyrate a compound of 2.78mg ethyl butyrate produces 6.32mg of CO2 and 2.58mg of H2O what is the empirical formula of the compound?
C3H6O the 3 and 6 are subscripts
What is the structural formula for ethyl alcohol?
Ethyl alcohol - ethanol - is a pure alcohol that is volatile and flammable. It has the structural formula of C2H6O.
Combustion of 2.22 mg of ethyl butyrate produces 5.06 mg of CO2 and 2.06 mg of H20 what is the empirical formula?
The chemical formula of ethyl butirate is C6H12O2.
What functional group is in ethyl butyrate?
ester
Chemical formula for ethyl acetate?
Molecular formula is C2H5CH3COO . Structural formula is CH3COOCH2CH3 .
What what is the structural formula for CH3CH2COCH3?
That IS the structural formula. The compound is called either 2-butanone or methyl ethyl ketone.
What is ethyl butyrate?
It is the ester of ethanol (C2H5OH) and butyric acid (butanoic acid, (HO-)(O=)C-C3H7 ) formula: (C2H5O-)(O=)C-C3H7
What is the structural formula chemical equation for ethyl ethanoate plus water?
CH3CH2OOCCH3 + H2O ===> CH3CH2OH + CH3COOH
What is the formula for butanone?
Butanone is the IUPAC name for methyl ethyl ketone (MEK). Empirical: C4H8O. Structural: CH3COCH2CH3.
What is the structural formula of 2-ethyl hexane?
CH3-CH=CH2-CH2-CH2-CH3 CH3
What is boiling point of butyl acetate?
Boiling point of ethyl butyrate: + 121 °C.
What is the condensed structural formula for 3 ethyl 2 5 dimethyloctane?
Ch3ch(ch3)ch(ch2ch3)ch2ch(ch3)ch2ch2ch3
