0
The balanced equation is this:
2K + 2H2O --> 2KOH + H2
Wiki User
∙ 15y ago
Wiki User
∙ 14y ago= H2 Co3 > H2o + Co2
Hydrogen Carbonate > Water + Carbonate
Wiki User
∙ 12y ago3 C3H8O3 + 7 K2Cr2O7 + 28 H2SO4 = 7 K2SO4 + 7 Cr2(SO4)3 + 9 CO2 + 40 H2O
Wiki User
∙ 12y agoThis question seems Impossible to answer. Because, Not enough information is given. What isC3H8O3. Maybe glycerol I think.
Wiki User
∙ 6y ago2KNO3 + H2CO3 ==> K2CO3 + 2HNO3 would be the balanced equation but since all of the species are ionizable and soluble, this reaction won't actually take place.
Wiki User
∙ 15y agok2co3+2hcl => 2kcl +h2o+co2
Wiki User
∙ 14y ago2 KO2 + 2 H2O → 2 KOH + O2 + H2O2
Wiki User
∙ 13y agoIt already is
Wiki User
∙ 10y agoK2o3 + H2o
Add your answer:
Earn +20 pts
How do you balance k2cr2o7 h2so4 c2h5oh -- cr2so43 k2so4 ch3cooh h2o?
2K2Cr2O7+ 8H2SO4+ 3C2H5OH --> 2Cr2(SO4)3+ 2K2SO4 + 3CH3COOH + 11H2O
Why H2SO4 is added in K2Cr2O7 during oxidation of alcohol?
K2Cr2O7+4H2SO4= K2SO4+Cr2(SO4)3+4H2O+3[O] As you can see during this reaction you obtain the O that you need for the oxidation of alcohol.
How do you balance FeO H2SO4?
FeO+H2SO4->FeSO4+H2O
What color will the solution be if you add H2SO4 to the K2CrO4 solution?
K2Cr2O7 + 6 KI + 7 H2So4 = Cr2(So4)3 + 4 K2So4 + 3 I2 + 7 H2O
What is the balance between k and h2so4?
It's K + H2SO4= K2SO4 +H2
How do you balance k2cr2o7 h2so4 c2h5oh -- cr2so43 k2so4 ch3cooh h2o?
2K2Cr2O7+ 8H2SO4+ 3C2H5OH --> 2Cr2(SO4)3+ 2K2SO4 + 3CH3COOH + 11H2O
Balance an equation by oxidation method?
k2cr2o7+FeSO4+H2SO4 --> Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O
Why H2SO4 is added in K2Cr2O7 during oxidation of alcohol?
K2Cr2O7+4H2SO4= K2SO4+Cr2(SO4)3+4H2O+3[O] As you can see during this reaction you obtain the O that you need for the oxidation of alcohol.
What is the formula for patassium dichromate?
The chemical formula of potassium dichromate is K2Cr2O7
How do you balance FeO H2SO4?
FeO+H2SO4->FeSO4+H2O
What color will the solution be if you add H2SO4 to the K2CrO4 solution?
K2Cr2O7 + 6 KI + 7 H2So4 = Cr2(So4)3 + 4 K2So4 + 3 I2 + 7 H2O
What is the balance between k and h2so4?
It's K + H2SO4= K2SO4 +H2
How do you convert acetylene to acetone?
C2H2 or (HCtriplebond CH) --20%H2SO4,HGSO4,60 to 80 dgree--> CH3CHO --k2Cr2O7/conc. H2SO4 [O]--> CH3COOH --Ca(OH)2--> (CH3COO)2Ca --Dry distillation-->CH3COCH3
Balance fes2 plus H2O plus o2 equals fe2o3 plus h2so4?
Fe2O3 + H2SO4
Product of potassium dicromate reacting with sulfur dioxide?
K2Cr2O7(aq) + 3SO2(g) + H2SO4(aq) Cr2(SO4)3(aq) + K2SO4(aq) + H2O(l)
What are the coefficients in K2Cr2O7 H2SO4 C2H5OH --- Cr2SO43 K2SO4 CH3COOH H2O?
2K2Cr2O7 + 2H2SO4 + 3C2H5OH ---> 2Cr2(SO4)3 + 2K2SO4 + 3CH3COOH + 11H2O.
What is the reaction of acidified pot dichromate with Hydrogen Sulphide?
Cr2O72-(aq) + 3SO2 (g) + 2H+(aq)= 2Cr3+ (aq) + 3SO4 2- (aq) H2O (l)
