0
K2Cr2O7+4H2SO4= K2SO4+Cr2(SO4)3+4H2O+3[O]
As you can see during this reaction you obtain the O that you need for the oxidation of alcohol.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
What is the oxidation number of H in H2SO4?
Oxidation number of h is 2
What is the chemical reaction of K2C2O4 plus HCl?
Isopropyl alcohol on oxidation forms acetone, but the further oxidation on heating produces acetic acid , carbon dioxide and water.CH3-CHOH-CH3 ------K2Cr2O7/H2SO4-----> CH3-CO-CH3 + H2OBalanced:K2Cr2O7 + 3 CH3CHOHCH3 + 4 H2SO4 --> 3 CH3COOH + Cr2(SO4)3 + K2SO4 + 4 H2O
What color will the solution be if you add H2SO4 to the K2CrO4 solution?
K2Cr2O7 + 6 KI + 7 H2So4 = Cr2(So4)3 + 4 K2So4 + 3 I2 + 7 H2O
How do you convert acetylene to acetone?
C2H2 or (HCtriplebond CH) --20%H2SO4,HGSO4,60 to 80 dgree--> CH3CHO --k2Cr2O7/conc. H2SO4 [O]--> CH3COOH --Ca(OH)2--> (CH3COO)2Ca --Dry distillation-->CH3COCH3
How do you balance k2cr2o7 h2so4 c2h5oh -- cr2so43 k2so4 ch3cooh h2o?
2K2Cr2O7+ 8H2SO4+ 3C2H5OH --> 2Cr2(SO4)3+ 2K2SO4 + 3CH3COOH + 11H2O
Balance an equation by oxidation method?
k2cr2o7+FeSO4+H2SO4 --> Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O
What is the oxidation number of H in H2SO4?
Oxidation number of h is 2
What is the chemical reaction of K2C2O4 plus HCl?
Isopropyl alcohol on oxidation forms acetone, but the further oxidation on heating produces acetic acid , carbon dioxide and water.CH3-CHOH-CH3 ------K2Cr2O7/H2SO4-----> CH3-CO-CH3 + H2OBalanced:K2Cr2O7 + 3 CH3CHOHCH3 + 4 H2SO4 --> 3 CH3COOH + Cr2(SO4)3 + K2SO4 + 4 H2O
What color will the solution be if you add H2SO4 to the K2CrO4 solution?
K2Cr2O7 + 6 KI + 7 H2So4 = Cr2(So4)3 + 4 K2So4 + 3 I2 + 7 H2O
How do you convert acetylene to acetone?
C2H2 or (HCtriplebond CH) --20%H2SO4,HGSO4,60 to 80 dgree--> CH3CHO --k2Cr2O7/conc. H2SO4 [O]--> CH3COOH --Ca(OH)2--> (CH3COO)2Ca --Dry distillation-->CH3COCH3
How do you balance k2cr2o7 h2so4 c2h5oh -- cr2so43 k2so4 ch3cooh h2o?
2K2Cr2O7+ 8H2SO4+ 3C2H5OH --> 2Cr2(SO4)3+ 2K2SO4 + 3CH3COOH + 11H2O
What is the oxidation number of H2SO4?
+1 for H +6 for S -2 for each O
In H2SO4 the oxidation number of H is that of S is and that ofO is .?
+1, +6, and -2 respectively
Product of potassium dicromate reacting with sulfur dioxide?
K2Cr2O7(aq) + 3SO2(g) + H2SO4(aq) Cr2(SO4)3(aq) + K2SO4(aq) + H2O(l)
What are the coefficients in K2Cr2O7 H2SO4 C2H5OH --- Cr2SO43 K2SO4 CH3COOH H2O?
2K2Cr2O7 + 2H2SO4 + 3C2H5OH ---> 2Cr2(SO4)3 + 2K2SO4 + 3CH3COOH + 11H2O.
What is the reaction of acidified pot dichromate with Hydrogen Sulphide?
Cr2O72-(aq) + 3SO2 (g) + 2H+(aq)= 2Cr3+ (aq) + 3SO4 2- (aq) H2O (l)
What is the oxidation number of all the elements in H2SO4?
H = +1 s = +6 o = -2
