0
What else can I help you with?
What is garnets element name?
The element name for garnet is aluminum silicate and its chemical formula is (Fe,Mg)3Al2(SiO4)3.
What is the structure of Silica?
SiO4
What is the formula for lithium silphite?
Li(sio4)
What is an almandite?
An almandite is another name for an almandine, a variety of garnet with a deep red colour, with the chemical formula Fe3Al2(SiO4)3.
What is the name of sio4 4-?
The 4 after the O means that there are 4 oxygen atoms.
What correct chemical formula silica tetrahedron?
The correct chemical formula for a silica tetrahedron is SiO4, representing one silicon atom bonded to four oxygen atoms in a tetrahedral shape.
What is the composition of garnet?
The chemical composition is CA3, AI2 , (SIO4)3
What is the valency for silicate radical?
Silicate radical is( SiO4) and its valency is -4
What is the chemical composition of garnet?
Garnet is a group of silicate minerals with the general formula X3Y2(SiO4)3, where X can be calcium, magnesium, ferrous iron, or manganese, and Y can be aluminum, ferric iron, or chromium. This composition gives different garnet species their unique colors and properties.
How can you recognize a silicate mineral from its chemical formula?
Silicate minerals typically contain the silicon-oxygen (SiO4) tetrahedron as their fundamental building unit. So, if a chemical formula contains SiO4 groups, it is likely a silicate mineral. Additionally, the presence of other cations such as aluminum, magnesium, or iron combined with SiO4 can also indicate a silicate mineral.
What causes the different colors of quartz?
Trace amounts of other minerals in the crystalline structure of the SiO4.
What is zoisite?
Zoisite is a mineral with orthorhombic crystals, chemical formula Ca2Al3(SiO4)(Si2O7)O(OH).
