0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
How man boron atoms are in a molecule of borax?
Borax has four boron atoms.
Who is the man who clarified the difference of molecules and atoms?
darna
Are the nuclear reactors the same processes occurring in the sun and reactors?
No. The sun produces energy by fusion. It is joining hydrogen atoms into larger helium atoms, which releases energy. Man-made nuclear reactors produce energy by fission. They break large atoms into smaller atoms, which also releases energy.
Who was the man who lived from 460 BC - 370 BC and was among the first to suggest the idea of atoms?
Democritus, an early Greek philosopher trying to counter the four elements concept; earth, air fire and water concept. Quite prescient of him actually.
Is natural gas man - made?
No. Humans do not make atoms or molecules (except, maybe, for synthetic ones made in chemical laboratories, or those from fission experiments in physics laboratories). Hint: Nothing man-made is natural. Nothing natural is man made.
What is the binary compound formula for plumbic bromide?
PbBr4
How man boron atoms are in a molecule of borax?
Borax has four boron atoms.
How man atoms does A1Sn have?
Check the spelling
Who is the man who clarified the difference of molecules and atoms?
darna
What sweetener integrates chlorine atoms?
nothing man
When this equation is balanced what is the coefficient for ni(no3)3. ni(no3)3 plus pbbr4 -- and gt nibr3 plus pb(no3)4?
Your formulas are not correct.
Who discovered atoms can be cut into smaller pieces?
A man from Greek
How man carbons does propene have?
Propene has 3 carbon atoms.
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
Who worked with gases in 1808 and published theory that atoms were hard spheres?
Spider man
Who is the man that proposed that atoms join together to make up compounds?
john dalton
What has the author Vassily Yemelyanov written?
Vassily Yemelyanov has written: 'Atoms in the service of man'
