0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
How many carbom atoms would an alkane chain have for there to be over 62 trillion isomers?
40
How many carbon atoms in the simplest cycloalkane?
Three carbon
What chemical series does methane belong to?
In chemistry, ethanol is a classified as an "alkane". It is also grouped as one of many "hydrocarbons", meaning it consists of only hydrogen and carbon atoms. It is also an "alcohol". I think ethane (alkane) and suffix of alcohol is how its name is derived.
How many atoms are present in 8.00 mol atoms?
48,177 134 32.1023 atoms
How many carbon atoms does 2-hexyne have?
In Alkane with n C-atoms there are 2n+2 H-atoms, so if n=12 then number H's is (2*12)+(2) = 26
How many Hydrogen atoms are in an Alkane with 16 Carbon atoms?
A non cyclic alkane always has a number of hydrogen atoms equal to 2c + 2, where c is the number of carbon atoms. Therefore, hexadecane, an alkane with 16 carbon atoms, will have 34 hydrogen atoms.
How many hydrogens are present on an alkane with 20 carbons?
An alkane with n carbon atoms has 2n + 2 hydrogen atoms.So, 42.
How many chain isomers are there for an alkane that contains seven carbon atoms?
At least 22 if you include cyclic compounds (cyclopentane, cyclobutane and cyclopropane) norborane, etc.
How many carbons atoms would be present in an alkane that contains 32 hydrogen atoms?
In an alkane the number of hydrogen atoms is two greater than twice the number of carbon atoms. If we reverse this rule, we find that the number of carbon atoms is one less than half the number of hydrogen atoms. 32/2=16 16-1=15 So our alkane would have 15 carbon atoms. This alkane would be pentadecane or one of its isomers.
An alkane with 3 carbon atoms would have how many hydrogen atoms in the molecule?
The generic formula for an alkane is CnH(2n + 2).Therefore, an alkane with 3 carbon atoms would have 8 hydrogen atoms.
If an acyclic alkane hydrocarbon contains n carbon atoms how many hydrogen atoms must it also contain?
Then the acyclic alkane hydrocarbon contains 2n+2 hydrogen atoms.
How many hydrogen atoms are present in 3-methyl-4-propyl-3-octene?
CH3CH2C(CH3)C(CH2CH2CH3)CH2CH2CH2CH3 24 hydrogen
How many carbom atoms would an alkane chain have for there to be over 62 trillion isomers?
40
How many total hydrogen atoms would be in a five carbon noncyclical alkane?
Alkanes are CnH2n+2, so for 5 carbon alkane, n = 10+2 =12 or 12 hydrogen atoms. It would be like this..CH3CH2CH2CH2CH3
How many carbon atoms are in a molecule if the molecule has 12 oxygen atoms?
It cannot be determined from the data supplied in the question:If it is a molecule containing carbon and oxygen are there other atoms presentDo the carbon atoms present in a cyclic mannerAre there double or triple bonds with any of the carbonsAre all carbon atoms commented to at least one other carbon atomAre the oxygen atoms connected to the carbon atoms by one or two bondsAre any of the oxygens present in the molecule but not connected to the carbonsAnd many more similar questions.
How many carbon atoms in the simplest cycloalkane?
Three carbon
What is the general formula for a alkane?
AnswerAlkenes have the general formula CnH2n. Cyclic alkenes have the general formula CnH2n-2 as do alkynes.Or you can say that for every carbon there are 2 hydrogens. 2n
