0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
Why is water a good pH buffer?
Water is not a good pH buffer.
Is NaC2H3O2 soluble?
The chemical compound sodium acetate, with the formula NaC2H3O2, dissociates completely. It is also known as sodium ethanoate or NaOAc.
Does melted NaC2H3O2 conduct electricity?
yes.
Do living tissues react more like water or more like a buffer?
Living tissues typically react more like a buffer than like water. This is because living tissues do not move easily.
How is water a buffer?
Theoretically any system in which both the acid/base and its conjugate are present can be used as a buffer. Since pure water has hydroxyl and hydronium ions present at 10-7 M it can be technically called a buffering system. However, since the concentrations are so small and water offers practically no buffering capacity and in a common sense water is not used as a buffer for any reactions, only as a solvent.
A 3.677 g sample of NaC2H3O2 • 3H2O is heated in a test tube until all of the water molecules have driven off. The NaC2H3O2 remaining in the test tube has a Ma’s’s of 2.216 g. Determine the ratio moles of water to moles NaC2H3O2 in the original compound?
I am 10
Is hch3o2 ionic or molecular?
molecular, no metals are involved
Why is water a good pH buffer?
Water is not a good pH buffer.
What is the chemical name for NaHCO3 and NaC2H3O2?
NaHCO3 is sodium bicarbonate. NaC2H3O2 is sodium acetate.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the total number of atoms in 14.5 g of sodium acetate?
NaC2H3O2 14.5 g NaC2H3O2 (1 mole NaC2H3O2/82.034 grams)(6.022 X 10^23/1 mole NaC2H3O2) = 1.06 X 10^23 atoms of sodium acetate
Is NaC2H3O2 soluble?
The chemical compound sodium acetate, with the formula NaC2H3O2, dissociates completely. It is also known as sodium ethanoate or NaOAc.
What is the PH when buffer is added to water?
Since we do not know the buffer or its concentration, we cannot provide an answer.
Why does the pH of an acetate buffer increases after dilution with water?
The pH of water is approximatly 7 (a neutral pH), and the acetate buffer has an acidic pH (less than 7) so when you add distilled water to the buffer the pH will increase.
What makes a buffer in a water system?
limestone
Does melted NaC2H3O2 conduct electricity?
yes.
In this procedure a 10x buffer is used if you have a 5x buffer and you want a total volume of 200ul what dilution would you perform to achieve the desired 1x concentration of buffer?
10x to 1x is a 1:10 dilution Therefore, add 1 part buffer, 9 parts DI-water If 100uL is 10uL (1 part buffer) and 90uL (9 parts DI-water) Then, 200ul (100 x 2) is 20uL (1 part buffer) and 180uL (9 parts DI-water)
