0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the detergent soap bar formula?
Sodium Stearate , or Sodium Palmate. The formulas are Sodium stearate CH3(CH2)16COO^-Na^+ Sodium, palmate CH3(CH2)13COO^-Na^+ Soaps that lather (dissolve) in salt water have the sodium ion replace by a potassium ion (K^+). This is because of the common ion effect of sodium in sodium stereate and sadium in sodium chloride of salt water.
Which kind of industry does soap belong to?
The chemical industry. Soap manufacture is the boiling of sodium hydroxide with stearic acid. Here is the chemical eq'n CH3(CH2)16COOH + NaOH = CH3(CH2)16COO^-Na^+ (soap) + H2O ThaT IS THE BASIS OF SOAP MAKING. However, many modern soaps have perfumes, oils added etc., to soften the astringency of sodium stearate. Other soaps/detergents are wholly organic chemicals/enzzymes, so that they react without much heat.
What is sodium caprylate?
Sodium caprylate is the same as sodium octanoate and has the formula, CH3(CH2)6COONa
What is a name for a familiar ionic compound?
Sodium chloride (NaCl) found in the home as TAble Salt. Also Sodium bi-carbonate (NaHCO3) as Baking #Poder. Sodium Carbonate (Na2CO3) as washing sode/ soda crystals. Sodium stearate ( NaOOC(CH2)16CH3) as soap.
What is products of the saponification of NaOH?
Saponification is the hydrolysis of fat in presence of caustic soda (NaOH), the products are Soap and Glycerin CH2-CO-R1 CH2-OH R1-COONa | | CH-CO-R2 + 3NaOH --------> CH-OH + R2-COONa | | CH2-CO-R3 CH2-OH R3-COONa (Fat) (Glycerin) (Soap)
How does soap react with the salts CaCl2 or MgCl2?
An insoluble salt is formed--commonly called soap scum. Soap is the potassium or sodium salt of fatty acids. When calcium takes the place of the sodium or potassium, a calcium salt is formed. This takes the form of a whitish precipitate.
What is the detergent soap bar formula?
Sodium Stearate , or Sodium Palmate. The formulas are Sodium stearate CH3(CH2)16COO^-Na^+ Sodium, palmate CH3(CH2)13COO^-Na^+ Soaps that lather (dissolve) in salt water have the sodium ion replace by a potassium ion (K^+). This is because of the common ion effect of sodium in sodium stereate and sadium in sodium chloride of salt water.
What is the formula in sodium tallowate?
The formula of sodium tallowate, otherwise known as soap is CH3CH2....COONa. Sodium tollowate is a salt of a fatty acid.
How soap detergent made of?
Soap was first made by boiling fat while adding some ingredients.Today, we've established that soap has a oxygen/hydrogen head and a hydrocarbonic tail.People've added dyes and perfumes in it too.Basic soap, with no additives, is made with fat and lye.
Which kind of industry does soap belong to?
The chemical industry. Soap manufacture is the boiling of sodium hydroxide with stearic acid. Here is the chemical eq'n CH3(CH2)16COOH + NaOH = CH3(CH2)16COO^-Na^+ (soap) + H2O ThaT IS THE BASIS OF SOAP MAKING. However, many modern soaps have perfumes, oils added etc., to soften the astringency of sodium stearate. Other soaps/detergents are wholly organic chemicals/enzzymes, so that they react without much heat.
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is sodium caprylate?
Sodium caprylate is the same as sodium octanoate and has the formula, CH3(CH2)6COONa
What is a name for a familiar ionic compound?
Sodium chloride (NaCl) found in the home as TAble Salt. Also Sodium bi-carbonate (NaHCO3) as Baking #Poder. Sodium Carbonate (Na2CO3) as washing sode/ soda crystals. Sodium stearate ( NaOOC(CH2)16CH3) as soap.
What is products of the saponification of NaOH?
Saponification is the hydrolysis of fat in presence of caustic soda (NaOH), the products are Soap and Glycerin CH2-CO-R1 CH2-OH R1-COONa | | CH-CO-R2 + 3NaOH --------> CH-OH + R2-COONa | | CH2-CO-R3 CH2-OH R3-COONa (Fat) (Glycerin) (Soap)
What is the formula for sodium laurate?
Sodium n-dodecanoate CH3-(CH2)10-C(=O)(-ONa)
Is CH3 CH216 CO2H polar or nonpolar?
The compound known as CH3(CH2)16CO2H is typically considered polar. Its molecules are able to have dipole moments, and it is soluble in water.
How is 1-bromobutane reacts with sodium hydroxide?
Ch3ch2ch2ch2br + NaOH -> ch3ch2ch2ch2oh + NaBr
