0
Is HC2H3O2 (aq) plus NaHCO3 (aq) NaC2H3O2 (aq) plus H2CO3 (aq) a double-displacement reaction?
Wiki User
∙ 7y agoWant this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the reaction state of C in NaHCO3?
NaHCO3 is the chemical formula f sodium bicarbonate.Carbon is here tetravalent.
Is C2H4O2 NaHCO3 a physical change?
No, the reactants acetic acid (C2H4O2) and sodium bicarbonate (NaHCO3) react chemically to make other compounds (products): sodium acetate (NaC2H3O2) and carbonic acid (H2CO3), decomposing easily to carbon dioxide (CO2) and water (H2O)
What is the gas and chemical reaction when aspirin is placed in sodium bicarbonate write chemical reaction?
The chemical reaction is:C9H8O4 + NaHCO3 = C9H7O4Na + H2O + CO2
What is the chemical reaction of muriatic acid and baking soda?
The reaction is: NaHCO3 + HCl = NaCl + CO2 + H2O The correct name of HCl is hydrochloric acid.
Will sodium bicarbonate produce a precipitate?
The reaction is:2 NaHCO3 + CaCl2 = CaCO3(s) + 2 NaCl + CO2 + H2O
What is the chemical name for NaHCO3 and NaC2H3O2?
NaHCO3 is sodium bicarbonate. NaC2H3O2 is sodium acetate.
What is the scientific equation for baking soda and lemon juice?
It's really two reactions in one. The first one's a double replacement:NaHCO3 + HC2H3O2 --> NaC2H3O2 + H2CO3Then, the carbonic acid immediately decomposes:H2CO3 --> H2O + CO2So the two together are:NaHCO3 + HC2H3O2 --> NaC2H3O2 + H2O + CO2
What chemical is made when baking soda and vinegar mix?
As an overview, acetic acid (HC2H3O2 (or C2H4O2 in solution), from the vinegar) reacts with aqueous sodium bicarbonate (NaHCO3), forming sodium acetate (NaC2H3O2) and carbonic acid (H2CO3). As also happens in carbonated water, the carbonic acid then dissociates into water and carbon dioxide (H2O and CO2). The chemical reaction would be (not balanced): C2H4O2 + NaHCO3 --initial reaction--> NaC2H3O2 + H2CO3 --bubbling--> NaC2H3O2 + H2O + CO2
What does baking soda and vingear make a gass?
There are two reaction pathways that get you that gas. First of all, baking soda, which is sodium bicarbonate (NaHCO3) reacts in a double replacement reaction with vinegar, which is acetic acid (HC2H3O2). Here's the equation for that: NaHCO3 + HC2H3O2 --> NaC2H3O2 + H2CO3. Your products are sodium acetate (a water-soluble salt) and carbonic acid. Then, the carbonic acid immediately decomposes into water and carbon dioxide. Here's the equation for that: H2CO3 --> H2O + CO2. The bubbles you see are the CO2 from the second reaction pathway.
What is the chemical equation of evaporation?
Evaporation is a physical process; no chemical equation.
What will happpen when baking soda mix withvinegar?
A chemical change occurs. What you get is two separate reactions that happen simultaneously. The first is a double-replacement reaction where the products are sodium acetate and carbonic acid: NaHCO3 + HC2H3O2 --> NaC2H3O2 + H2CO3 The second is a decomposition reaction involving the carbonic acid, and the products are water and carbon dioxide: H2CO3 --> H2O + CO2 The CO2 are the bubbles you see in the reaction. This reaction is endothermic, meaning it gets cooler. It also makes a big foamy mess.
How do you balance chemical equation fecl2 plus na2co3 yields nacl plus feco3?
Balancing equation of FeCl2 and Na2CO3 yield 2NaCl and FeCO3
What type of reaction will you get by mixing vinegar and baking soda?
By mixing vinegar and baking soda you get Fizz. this is a reaction between CH3COOH or Acetic acid(commonly known as vinegar) and NaHCO3 or Sodium bicarbonate (commonly known as baking soda).The acetic acid donates a H+ and the Sodium dissolves into the aqueous solution as the [HCO3]- reacts with the H+ to form water and Carbon dioxide. This Carbon dioxide exiting the solution creates that fizz.
Is the chemical reaction for C2H4O2 NaHCO3 a physical change?
No, the reactants acetic acid (C2H4O2) and sodium bicarbonate (NaHCO3) react chemically to make other compounds (products): sodium acetate (NaC2H3O2) and carbonic acid (H2CO3), decomposing easily to carbon dioxide (CO2) and water (H2O)
How does the chemical in the soap react to the vinegar?
HC2H3O2(aq) + NaHCO3 (s) --> NaC2H3O2(aq) + CO2(g) + H2O(l) This equation is balanced. In other terms: Vinegar and baking soda reacts to form sodium acetate in solution, carbon dioxide gas, and water. The "fizz" that is seen is the production of carbon dioxide gas.
What kind of reaction will happen when vingear and baking soda?
The short answer is Chemical Reaction.. To Expand the answer this is what happens: NaHCO3(baking Soda) + HC2H3O2(Acetic Acid) → NaC2H3O2( Sodium Acetate) + H2O(Water) + CO2(Carbon Dioxide) Sodium Bicarbonate (Baking Soda) + Acetic Acid (Vinegar) = Sodium Acetate + Water + Carbon Dioxide
Does vinegar diluted with water still have a chemical reaction with baking soda?
HC2H3O2(aq) + NaHCO3 (s) --> NaC2H3O2(aq) + CO2(g) + H2O(l) This equation is balanced. In other terms: Vinegar and baking soda reacts to form sodium acetate in solution, carbon dioxide gas, and water. The "fizz" that is seen is the production of carbon dioxide gas. ----------------------------------------------------------------------------------------------------- CH3COOH(aq)+NaHCO3(s)--------- CH3COONa(aq)+H2O(l)+CO2(g)
