0
What else can I help you with?
Is maltose an amino acid?
yes it is.but only after it is mixed with the amylase that comes from pancreatic juice.
Is olive oil an essential fatty acid?
No, it's not a fatty acid or essential fatty acid.
Is omega 3 a simple carbohydrate?
Omega 3 is an essential polyunsaturated fatty acid and not a carbohydrate.
What type of fatty acid is a propanoic acid?
Propionic acis is not a fatty acid.
If you isolate a fatty acid with one double bond you know the fatty acid is a?
A monounsaturated fat
What is the difference between a hydrocarbon and a fatty acid?
The difference between a hydrocarbon and a fatty acid is that a fatty acid is a hydrocarbon chain with a carboxylic acid head.
Name three saturated and three unsaturated fatty acids?
Fatty Acids are the name we use to give Carboxylic Acids with long hydrocarbon chains.These hydrocarbon chains can contain one or more double bonds, which we can refer to the Fatty Acid as being unsaturated.Saturated fatty acids are simple long chains.Some Examples:SaturatedStearic Acid - CH3(CH2)16COOHLauric Acid - CH3(CH2)10COOHArachidic Acid - CH3(CH2)18COOHUnsaturatedOleic Acid - CH3(CH2)7CH=CH(CH2)7COOHErucic Acid - CH3(CH2)7CH=CH(CH2)11COOHPalmitoleic Acid - CH3(CH2)5CH=CH(CH2)7COOH
What is maltose used for?
Maltose is used for: milkshakes, malted milk, cakes and beverages. Maltose syrup is a sweetner discovered from boiling starch and acid to make a sweet tasting substance. Maltose is used for: milkshakes, malted milk, cakes and beverages. Maltose syrup is a sweetner discovered from boiling starch and acid to make a sweet tasting substance.
What is volatile fatty acid number?
No one fatty acid is volatile.
A(n) fatty acid is the building block of fats?
fatty acid is the answer
What is the balanced equation for fatty acid and sodium hydroxide?
The balanced equation for the reaction between a fatty acid (such as oleic acid) and sodium hydroxide is: Fatty acid + Sodium hydroxide -> Soap (sodium salt of the fatty acid) + Water
Is oil a fatty acid?
it is a fatty
