0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
Should dihydrogen monoxide be banned?
I do not think water will be banned any time soon!
How many kilogram of lpg equal 1ton?
In those countries that use the long ton (2240 lb), eg UK1 ton ≈ 1016 kg ⇒ 1016 kg of lpg (or any other substance) is approximately equal 1 tonIn those countries that use the short ton (2000 lb), eg USA1 ton ≈ 907 kg ⇒ 907 kg of lpg (or any other substance) is approximately equal 1 ton
What are examples of state?
the US state of Louisiana | No states are countries that have sovereignty, so USA, Russia, Argentina, basically any country that has a permanent population, sovereignty, has a defined border, and can protect their sovereignty.
What does the word carbon means in African language?
"African" is not a language. Africa is a continent that contains 54 countries and more than 2100 completely different languages. Some estimates place the number of languages at around 3000.If you have any questions about African languages, you will have to specify the language.The most prominent languages spoken in Africa are:AfrikaansAmharicArabicEnglishFrenchFulaHausaIgboOromaSomaliSwahiliYorubaZulu
Does oxygen have malleability?
no it does not have any no it does not have any
What type of food has MSG?
Any foods that have the label "artificial flavors" (like capri-sun or most drinks) contain monosodium glutamate. Also the food container may just list monosodium glutamate on the back under "Ingredients".
Is hidden valley ranch dressing gluten free?
It contains monosodium glutamate. So, no. You are wrong. Monosodium glutamate is not derived from wheat. Its not good for you by any means but it is safe from a celiac standpoint. Hidden Valley original Ranch is safe. Hidden Valley is a company that claims that it will always list gluten ingredients on its products.
Has any other countries banned DDT?
Practically all countries banned DDT.
What countries is evanescence banned?
None, there is nothing dangerous/r-rated about there music
Is cheese culture banned in any countries?
No
If glutamic acid has the formula HC5H8NO4 then what is the formula of sodium glutamate commonly known as MSG or monosodium glutamate?
MSG, 2-aminopentanedioic acid, is C5H8NNaO4 and has a SMILES (simplified molecular input line entry specification) of C(CC(=O)O)C(C(=O)O-)N.[Na+]. A link is provided to the Wikipedia article on MSG.
Do Girl Scout cookies have glutamate in them?
Glutamate is not listed as an ingredient for any Girl Scout cookie.
Have any medications been invented to improve taste?
No, though some substances have been used to improve the perception of taste of food in the mouth. MSG (monosodium glutamate) has been used in Chinese recipes and in meat flavoring products to increase the flavor, especially a salty component.
Was dead space banned in any countries?
Yes. In China, Japan, and Germany.
Is smoking banned in any countries?
As matter of fact, only one country left in the world has banned smoking, and it is the tiny Asian nation of Bhutan in the Himalayas.
What countries is George Bush banned from?
As far as we know, President Obama is not "banned" from any countries. As with all presidents, he is more popular in some countries than in others, and certain countries like Iran or North Korea may have policies that discourage a US president from visiting, but it is doubtful that there is any official "ban" in place anywhere.
Are there any countries NOT competing in the Olympic games?
Not all countries compete; some smaller countries don't have any suitable athletes. Iraq has recently been banned from competing because of political interference in the sport selection process.
