0
In the process of doing some research on SMS I came across this information written some time ago on epinions.com , see http://www.epinions.com/content_3850018948 It was an interesting read that I found somewhat helpful.
Wiki User
∙ 15y ago
Add your answer:
Earn +20 pts
Is sodium myreth sulfate like sodium chloride?
No, they are salts, but it is a big difference between these compounds.
Are sodium laurel sulfate ans sodium lauryl sulfoacetate the same?
Yes ! Sodium laurel sulfate=Sodium lauryl sulfate=Sodium dodecyl sulfate (CH3(CH2)11OSO3Na). But sodium laureth sulfate is a different compound.
What happens when lead II nitrate and sodium sulfate react?
The lead nitrate and sodium sulfate precipitate together and becomes lead sulfate and sodium nitrate. lead nitrate+ sodium sulfate --> lead sulfate + sodium nitrate
Is sodium sulfate an aqueous or a solid?
Sodium sulfate is a solid.
Is sodium sulfate and sodium sulfide the same?
No. Sodium sulfate has the formula Na2SO4, but sodium sulfide has the formula Na2S and substantially different chemical properties from those of sodium sulfate.
Is sodium myreth sulfate like sodium chloride?
No, they are salts, but it is a big difference between these compounds.
What is the difference between sodium sulfite and sodium sulfate?
No, these two chemicals are not the same. The difference is well-explained by the following excerpts from Wikipedia, accessed 2013 Feb 11:"[A generic] chemical formula for sodium laureth sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3Na. Sometimes the number represented by n is specified in the name, for example laureth-2 sulfate. The product is heterogeneous in the number of ethoxyl groups, where n is the mean. ... The related surfactant sodium lauryl sulfate (also known as sodium dodecyl sulfate or SLS) is produced similarly, but without the ethoxylation step."
Are sodium laurel sulfate ans sodium lauryl sulfoacetate the same?
Yes ! Sodium laurel sulfate=Sodium lauryl sulfate=Sodium dodecyl sulfate (CH3(CH2)11OSO3Na). But sodium laureth sulfate is a different compound.
What happens when lead II nitrate and sodium sulfate react?
The lead nitrate and sodium sulfate precipitate together and becomes lead sulfate and sodium nitrate. lead nitrate+ sodium sulfate --> lead sulfate + sodium nitrate
Is sodium sulfate an aqueous or a solid?
Sodium sulfate is a solid.
Is sodium sulfate and sodium sulfide the same?
No. Sodium sulfate has the formula Na2SO4, but sodium sulfide has the formula Na2S and substantially different chemical properties from those of sodium sulfate.
The formula for sodium sulfate?
Na2SO4 is the chemical formula for sodium sulfate.
What is the fomula for sodium sulfate?
The chemical formula of sodium sulfate is Na2SO4.
What is the solubility of sodium sulfate in ethanol?
Sodium sulfate is not soluble in ethanol.
Sodium sulfate formula?
The chemical formula of sodium sulfate is Na2SO4.
What does sodium hydroxide and sodium sulfate react to form?
Sodium hydroxide and sodium sulfate don't actually react.
What are the formula units for sodium sulfide sodium sulfite and sodium sulfate?
Sodium sulfide: Na2S Sodium sulfite: Na2SO3 Sodium sulfate: Na2SO4
