0
What else can I help you with?
Is sodium myreth sulfate like sodium chloride?
No, sodium myreth sulfate and sodium chloride are different compounds. Sodium myreth sulfate is a surfactant commonly used in personal care products for its cleansing properties, while sodium chloride is table salt commonly used as a seasoning or food preservative.
Is sodium laureth sulfate the same as sodium lauryl sulfate?
No, sodium laureth sulfate and sodium lauryl sulfate are not the same. Sodium laureth sulfate is a milder surfactant compared to sodium lauryl sulfate, which can be harsher on the skin.
Is sodium lauryl sulfate the same as sodium laureth sulfate?
No, sodium lauryl sulfate and sodium laureth sulfate are not the same. Sodium lauryl sulfate is a harsher cleansing agent, while sodium laureth sulfate is milder and less irritating to the skin.
Is sodium laureth sulfate considered a sulfate?
Yes, sodium laureth sulfate is considered a sulfate.
What is the name for Na2SO4?
sodium sulfate
Is sodium myreth sulfate like sodium chloride?
No, sodium myreth sulfate and sodium chloride are different compounds. Sodium myreth sulfate is a surfactant commonly used in personal care products for its cleansing properties, while sodium chloride is table salt commonly used as a seasoning or food preservative.
Is sodium laureth sulfate the same as sodium lauryl sulfate?
No, sodium laureth sulfate and sodium lauryl sulfate are not the same. Sodium laureth sulfate is a milder surfactant compared to sodium lauryl sulfate, which can be harsher on the skin.
Is sodium lauryl sulfate the same as sodium laureth sulfate?
No, sodium lauryl sulfate and sodium laureth sulfate are not the same. Sodium lauryl sulfate is a harsher cleansing agent, while sodium laureth sulfate is milder and less irritating to the skin.
What is the difference between sodium sulfite and sodium sulfate?
No, these two chemicals are not the same. The difference is well-explained by the following excerpts from Wikipedia, accessed 2013 Feb 11:"[A generic] chemical formula for sodium laureth sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3Na. Sometimes the number represented by n is specified in the name, for example laureth-2 sulfate. The product is heterogeneous in the number of ethoxyl groups, where n is the mean. ... The related surfactant sodium lauryl sulfate (also known as sodium dodecyl sulfate or SLS) is produced similarly, but without the ethoxylation step."
Is sodium laureth sulfate considered a sulfate?
Yes, sodium laureth sulfate is considered a sulfate.
What is the name for Na2SO4?
sodium sulfate
Are sodium lauryl sulfate and sodium laureth sulfate the same?
No, sodium lauryl sulfate and sodium laureth sulfate are not the same. While they are both surfactants commonly found in personal care products, sodium laureth sulfate is considered to be milder and less irritating than sodium lauryl sulfate.
What is the name for compound Na2SO4?
Na2SO4 is sodium sulfate sometimes called disodium sulfate. Sodium sulfate from a natural source is known as thenardate and was formerly called Glauber's Salt.
What is the chemistry name for Na2SO4?
Sodium sulfate.
What is the fomula for sodium sulfate?
The chemical formula of sodium sulfate is Na2SO4.
The formula for sodium sulfate?
Na2SO4 is the chemical formula for sodium sulfate.
What does sodium hydroxide and sodium sulfate react to form?
Sodium hydroxide and sodium sulfate don't actually react.
