In the process of doing some research on SMS I came across this information written some time ago on epinions.com , see http://www.epinions.com/content_3850018948 It was an interesting read that I found somewhat helpful.
No, sodium myreth sulfate and sodium chloride are different compounds. Sodium myreth sulfate is a surfactant commonly used in personal care products for its cleansing properties, while sodium chloride is table salt commonly used as a seasoning or food preservative.
No, sodium laureth sulfate and sodium lauryl sulfate are not the same. Sodium laureth sulfate is a milder surfactant compared to sodium lauryl sulfate, which can be harsher on the skin.
No, sodium lauryl sulfate and sodium laureth sulfate are not the same. Sodium lauryl sulfate is a harsher cleansing agent, while sodium laureth sulfate is milder and less irritating to the skin.
Yes, sodium laureth sulfate is considered a sulfate.
sodium sulfate
No, sodium myreth sulfate and sodium chloride are different compounds. Sodium myreth sulfate is a surfactant commonly used in personal care products for its cleansing properties, while sodium chloride is table salt commonly used as a seasoning or food preservative.
No, sodium laureth sulfate and sodium lauryl sulfate are not the same. Sodium laureth sulfate is a milder surfactant compared to sodium lauryl sulfate, which can be harsher on the skin.
No, these two chemicals are not the same. The difference is well-explained by the following excerpts from Wikipedia, accessed 2013 Feb 11:"[A generic] chemical formula for sodium laureth sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3Na. Sometimes the number represented by n is specified in the name, for example laureth-2 sulfate. The product is heterogeneous in the number of ethoxyl groups, where n is the mean. ... The related surfactant sodium lauryl sulfate (also known as sodium dodecyl sulfate or SLS) is produced similarly, but without the ethoxylation step."
No, sodium lauryl sulfate and sodium laureth sulfate are not the same. Sodium lauryl sulfate is a harsher cleansing agent, while sodium laureth sulfate is milder and less irritating to the skin.
Yes, sodium laureth sulfate is considered a sulfate.
sodium sulfate
No, sodium lauryl sulfate and sodium laureth sulfate are not the same. While they are both surfactants commonly found in personal care products, sodium laureth sulfate is considered to be milder and less irritating than sodium lauryl sulfate.
Na2SO4 is sodium sulfate sometimes called disodium sulfate. Sodium sulfate from a natural source is known as thenardate and was formerly called Glauber's Salt.
Sodium sulfate.
The chemical formula of sodium sulfate is Na2SO4.
Na2SO4 is the chemical formula for sodium sulfate.
Sodium hydroxide and sodium sulfate don't actually react.