0
No, these two chemicals are not the same. The difference is well-explained by the following excerpts from Wikipedia, accessed 2013 Feb 11:
"[A generic] chemical formula for sodium laureth sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3Na. Sometimes the number represented by n is specified in the name, for example laureth-2 sulfate. The product is heterogeneous in the number of ethoxyl groups, where n is the mean. ... The related surfactant sodium lauryl sulfate (also known as sodium dodecyl sulfate or SLS) is produced similarly, but without the ethoxylation step."
What else can I help you with?
How does sodium sulfite remove oxygen?
Sodium sulfite acts as a reducing agent, meaning it can donate electrons to oxygen atoms. When sodium sulfite is added to a system with oxygen present, it reacts with the oxygen molecules and forms sodium sulfate, effectively removing the oxygen from the system.
What is the difference between sulfate and sulphites?
Aside from the difference between American and British spelling and the singular and plural, sulfate ions have the formula SO4-2 and sulphite ions have the formula SO3-2. Chemically, then, the difference is one oxygen atom per ion.
What is the name for Na2SO2?
Sodium Sulfate Na has a charge of 1+ and Sulfate (SO4) has a charge of 3- So, in order for them to bond, you need to have 3 Sodium atoms for every 1 Sulfate molecules. Na3SO4
Detail of reaction between sodium sulphite and hydrogen peroxide?
When sodium sulfite reacts with hydrogen peroxide, a redox reaction takes place. The hydrogen peroxide oxidizes the sulfite ion in sodium sulfite to form sulfate ions, and itself is reduced to water. This reaction is used in various industrial processes and wastewater treatment to remove sulfur dioxide.
Sodium carbonate reacts with excess of sulfur dioxide?
The reaction between sodium carbonate and excess sulfur dioxide results in the formation of sodium sulfite, Na2SO3, as the main product. This reaction is commonly used in the chemical industry to produce sodium sulfite, which is utilized in various applications like paper pulping and water treatment.
What are the formula units for sodium sulfide sodium sulfite and sodium sulfate?
Sodium sulfide: Na2S Sodium sulfite: Na2SO3 Sodium sulfate: Na2SO4
How does sodium sulfite remove oxygen?
Sodium sulfite acts as a reducing agent, meaning it can donate electrons to oxygen atoms. When sodium sulfite is added to a system with oxygen present, it reacts with the oxygen molecules and forms sodium sulfate, effectively removing the oxygen from the system.
What is the difference between sodium laureth sulfate and sodium lauryl sulfate?
Sodium laureth sulfate and sodium lauryl sulfate are both surfactants commonly used in personal care products. The main difference between them is in their chemical structure. Sodium lauryl sulfate is a harsher surfactant that can be more irritating to the skin, while sodium laureth sulfate is milder and less likely to cause irritation.
What is the difference between sodium lauryl sulfate and sodium laureth sulfate?
Sodium lauryl sulfate and sodium laureth sulfate are both surfactants commonly found in personal care products. The main difference between them is in their chemical structure. Sodium lauryl sulfate is a harsher cleansing agent that can be drying to the skin, while sodium laureth sulfate is a milder surfactant that is often preferred for sensitive skin.
Does barium sulphite precipitate when barium chloride is added to sodium sulphite solution?
Yes, barium sulfate precipitates when barium chloride is added to a sodium sulfite solution due to a double displacement reaction where barium ions from barium chloride react with sulfite ions from sodium sulfite to form a insoluble barium sulfate precipitate.
What is the chemical name of Na2S2O4?
Sodium thiosulfate or Sodium Hyposulphite.
What names are in this compound Na2SO3?
Na2SO4 is the ionic compound sodium sulfate.
What is the difference between sulfate and sulphites?
Aside from the difference between American and British spelling and the singular and plural, sulfate ions have the formula SO4-2 and sulphite ions have the formula SO3-2. Chemically, then, the difference is one oxygen atom per ion.
What is the name for Na2SO2?
Sodium Sulfate Na has a charge of 1+ and Sulfate (SO4) has a charge of 3- So, in order for them to bond, you need to have 3 Sodium atoms for every 1 Sulfate molecules. Na3SO4
What is the difference between sodium sulfate and sodium lauryl sulfate?
Sodium sulfate is a salt commonly used in detergents and textiles, while sodium lauryl sulfate is a surfactant found in personal care products like shampoo and toothpaste. The main difference is their chemical structures and uses, with sodium lauryl sulfate being more commonly used in personal care products for its foaming and cleansing properties.
Chemical formula for sodium hydrosulfite?
Hydrogen sulfite is the bisulfite anion, or HSO3-.Sulfite is SO32-.Do not confuse sulfite (SO32-) with sulfide (S2-), or sulfate (SO42-).
Detail of reaction between sodium sulphite and hydrogen peroxide?
When sodium sulfite reacts with hydrogen peroxide, a redox reaction takes place. The hydrogen peroxide oxidizes the sulfite ion in sodium sulfite to form sulfate ions, and itself is reduced to water. This reaction is used in various industrial processes and wastewater treatment to remove sulfur dioxide.
