0
What else can I help you with?
What is the difference between iron 2 sulfate and iron 3 sulfate?
Iron (II) sulfate has iron in the +2 oxidation state, while iron (III) sulfate has iron in the +3 oxidation state. This means iron (II) sulfate has a lower charge on the iron ion compared to iron (III) sulfate, which affects its chemical properties and reactivity.
What is the difference between ammonium sulfate and ammonium persulfate?
Ammonium sulfate is a salt compound containing ammonium and sulfate ions, commonly used as a fertilizer. Ammonium persulfate, on the other hand, is a powerful oxidizing agent used in polymerization reactions and as an etchant in the electronics industry. Ammonium persulfate contains additional oxygen atoms compared to ammonium sulfate, giving it stronger oxidizing properties.
What is the difference between 210mg ferrous fumerate and 200mg ferrous sulphate?
The main difference between ferrous fumarate and ferrous sulfate is the type of iron salt they contain. Ferrous fumarate contains ferrous iron bound to fumaric acid, while ferrous sulfate contains ferrous iron bound to sulfuric acid. Ferrous fumarate is often considered to have better absorption and fewer gastrointestinal side effects compared to ferrous sulfate.
What is the difference between sodium sulfite and sodium sulfate?
No, these two chemicals are not the same. The difference is well-explained by the following excerpts from Wikipedia, accessed 2013 Feb 11:"[A generic] chemical formula for sodium laureth sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3Na. Sometimes the number represented by n is specified in the name, for example laureth-2 sulfate. The product is heterogeneous in the number of ethoxyl groups, where n is the mean. ... The related surfactant sodium lauryl sulfate (also known as sodium dodecyl sulfate or SLS) is produced similarly, but without the ethoxylation step."
What kind of bond is copper sulfate?
metallice bonding ================ Rather than metallic bonding, some might assume the bonds between copper and sulfate to be ionic. Keep in mind that there are no 100% ionic compounds. Bonds are not either ionic or covalent. Instead bonds like along a continuum and have characteristics of both. The bonds within the sulfate ion are clearly more covalent than ionic. So we are more concerned about the bonds between copper and oxygen. We can determine the percent ionic character in a bond from the electronegativity difference and this equation: %ionic character = 100(1-e(-DEN^2/4)) The electronegativity difference between copper and oxygen is 1.54. That translates to a bond that is about 45% ionic. Therefore, the bonds in copper (II) sulfate are more covalent than they are ionic. The bottom line is that solid copper (II) sulfate exists in a lattice of SO4 units and copper atoms in which the copper atoms are polar covalently bonded to oxygen.
What is the difference between sodium laureth sulfate and sodium lauryl sulfate?
Sodium laureth sulfate and sodium lauryl sulfate are both surfactants commonly used in personal care products. The main difference between them is in their chemical structure. Sodium lauryl sulfate is a harsher surfactant that can be more irritating to the skin, while sodium laureth sulfate is milder and less likely to cause irritation.
What is the difference between sodium lauryl sulfate and sodium laureth sulfate?
Sodium lauryl sulfate and sodium laureth sulfate are both surfactants commonly found in personal care products. The main difference between them is in their chemical structure. Sodium lauryl sulfate is a harsher cleansing agent that can be drying to the skin, while sodium laureth sulfate is a milder surfactant that is often preferred for sensitive skin.
What devices does burgess use to show the reader the difference between a bromide and a sulphite?
Burgess uses language and behavior to show the differences between bromides and sulphites. Bromides have a passive, conformist attitude, while sulphites are more rebellious and aggressive in their actions. The author also highlights the contrasting opinions and ideologies of the two groups to emphasize their distinct characteristics.
Can a drug test distinguish the difference between morphine sulfate immediate release from morphine sulfate extended release?
No they are both opiates
What is the difference between magnesium and magnesium sulfate?
Magnesium oxide is MgO and magnesium sulfate is MgSO4. Two completely different compounds.
What is the difference between hydroxychloroquine sulfate and hydroxychloroquine?
Hydroxychloroquine is the active ingredient in both hydroxychloroquine sulfate and hydroxychloroquine. The addition of sulfate in hydroxychloroquine sulfate refers to the specific salt form used in the medication.
What is the Difference between aluminum sulphate and aluminum sulfate?
There is no difference between aluminum sulphate and aluminum sulfate - they are the same compound, with "sulphate" and "sulfate" being alternative spellings for the chemical formula Al2(SO4)3. The spelling "sulphate" is more common in British English, while "sulfate" is more common in American English.
What group is stephanite in?
sulphites
What is the difference between sodium sulfate and sodium lauryl sulfate?
Sodium sulfate is a salt commonly used in detergents and textiles, while sodium lauryl sulfate is a surfactant found in personal care products like shampoo and toothpaste. The main difference is their chemical structures and uses, with sodium lauryl sulfate being more commonly used in personal care products for its foaming and cleansing properties.
Are sulphites gluten free?
Yes
What is the difference between iron 2 sulfate and iron 3 sulfate?
Iron (II) sulfate has iron in the +2 oxidation state, while iron (III) sulfate has iron in the +3 oxidation state. This means iron (II) sulfate has a lower charge on the iron ion compared to iron (III) sulfate, which affects its chemical properties and reactivity.
What are sulphites?
Sulphites are additives used in food and beverages to prevent spoilage and maintain freshness. They can also occur naturally in some foods and drinks. Sulphites are known to cause allergic reactions in some individuals, so they must be declared on food labels.
