The products of propanol combustion are water and carbon dioxide.
the reaction is OH ç CH3 CH = CH CH2 CH3 + 2 H2O ® CH3 CH CH CH2 CH3 ç OH
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
CH3-CH2-CH3 is a gas Propane.
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
Ch3 -ch2 -o-c(o)-ch2-ch2-ch2-ch2-ch2-ch2-ch3
2C4H10 + 13O2 = 8CO2 +10H2O
Pentanol
ch3-ch2-chohchch3ch3 ---- the upper written oh and ch3 are substituents at c3 and c2 respectively ---- ---- (CH3)2CH-CH(OH)-CH2-CH3
ch3-ch2-chohchch3ch3 ---- the upper written oh and ch3 are substituents at c3 and c2 respectively ---- ---- (CH3)2CH-CH(OH)-CH2-CH3
butanol
the reaction is OH ç CH3 CH = CH CH2 CH3 + 2 H2O ® CH3 CH CH CH2 CH3 ç OH
This reaction depends upon ratio of both the reactants, ethanol with a largequantity of concentrated sulphuric acid on heating produces ethene. CH3-CH2-OH = CH2=CH2 + H2O But if ethanol is in excess then Diethyl ether is formed. 2CH3-CH2-OH = CH3-CH2-O-CH2-CH3 + H2O
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
C2H6O could be 1) Ethanol, CH3CH2OH 2) Dimethyl ether, CH3OCH3
1-Butanol
C2h5-oh
OCTANE