0
What else can I help you with?
What compound is CH3-CH2-CH-CH3-CH3?
It is a hydrocarbon: Butyl group. As it has 4 carbons it has prefix "but-" and it has general formula CnH2n+1 so it is part of Alkyl group. Accurately it is butyl group: CH3-CH2-CH2-CH2- Remember it has a bond protruding out from last CH2
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What is the nomenclature for ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3?
The molecule you have described (C8H18) is Octane. The number of carbon atoms in the longest molecule chain give the first part of the IUPAC name.C Atom Number - First Part1 ---------------------Meth2 ---------------------Eth3 ---------------------Prop4 ---------------------But5 ---------------------Pent6 ---------------------Hex7 ---------------------Hept8 ---------------------OctType of Molecule - SuffixAlkane ----------------aneAlkene ----------------eneAlcohol ----------------anolKetone ---------------oneAldehyde -------------analCarboxylic Acid ------oic Acid
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the nomenclature name for ch3-ch2-chch-ch2-ch2-ch2-ch3?
oct-3-ene (IUPAC)8 carbonsone double-bond on the third carbonno branches
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What compound is CH3-CH2-CH-CH3-CH3?
It is a hydrocarbon: Butyl group. As it has 4 carbons it has prefix "but-" and it has general formula CnH2n+1 so it is part of Alkyl group. Accurately it is butyl group: CH3-CH2-CH2-CH2- Remember it has a bond protruding out from last CH2
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
What is the proper configuration of a straight chain isomer of hexane?
Ch3-ch2-ch2-ch2-ch2-ch3
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
How do you name this molecule ch3 ch2 ch3?
This molecule is named propane.
What is the nomenclature for ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3?
The molecule you have described (C8H18) is Octane. The number of carbon atoms in the longest molecule chain give the first part of the IUPAC name.C Atom Number - First Part1 ---------------------Meth2 ---------------------Eth3 ---------------------Prop4 ---------------------But5 ---------------------Pent6 ---------------------Hex7 ---------------------Hept8 ---------------------OctType of Molecule - SuffixAlkane ----------------aneAlkene ----------------eneAlcohol ----------------anolKetone ---------------oneAldehyde -------------analCarboxylic Acid ------oic Acid
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
Decane can be broken during this process to form 1- butene and 2 - methylpentanewrite anequation using structural formulae to show this reaction?
The process mentioned involves the breaking of a C-C bond in decane to form 1-butene and 2-methylpentane. The structural formula equation is: CH3-(CH2)8-CH3 → CH2=CH-CH2-CH3 + CH3-CH(CH3)-CH2-CH2-CH3.
