0
H2O(Water; particularly vapor), CO2(Carbon dioxide), CH4(Methane), N2O(Nitrous oxide), Particulate Matter, and CFCs(Chlorofluorocarbons)
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
What substances are found in oil?
fatty acids and glycerol
What substances have the most potential to damage the ozone and where are they found?
The substances having the most potential are CFC's. They can be found as coolant in various areas.
What are the 4 organic substances found in your body and needed in your body?
The 4 organic substances found in your body are carbohydrates, lipids, proteins and nucleic acids
Is air a substances or a mixture?
Air is a mixture because it consists of more than 1 atom.
What are 3 substances in air which are elements?
Oxygen, Nitrogen, Estrogen
Name two substances in which the element hydrogen is present?
Hydrogen can be found in water and air.
Give 5 examlpes of acid and basic substances found in plant and animals?
give me reply
How are ozone pollutions created?
The substances that are causing ozone layer depletion are freons, CFC's etc.. These are called as ozone-depleting substances (ODS). These are generally found in refrigirators and air conditioners.
Which substance in the air is the solvent and which substances are the solutes?
Moisture in the air works as solvent and soluble substances present in the air are solutes.
Can pure iron be found on earths crust?
No because iron reacts with various substances including oxygen in the air to produce rust.
Where is nitrogen found in its elemental form?
Nitrogen gas is found in the air. It is the most abundant gas there, comprising about 4/5 of the air.
What are the pollutants found in air?
Some pollutants found in the air are: 1. Ozone 2. Particulate Matter 3. Carbon Monoxide 4. Nitrogen Oxides 5. Sulfur Dioxide 6. Lead
Can the substances in air be separaterated?
yes it can be filtered by an air filter
What substances are found in oil?
fatty acids and glycerol
What substances are element?
All of the substances found in the Periodic Table are considered as elements. None others are.
What are some substances that are elements?
air, water
What are the unwanted substances in the air and water?
Pollution?
