0
Methane. It has the chemical formula CH4 which is why it is called this.
Common heating gas is natural gas. The main ingredient of natural gas is methane.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
What is the common name of CH4?
Methane :)
Common name for methane?
The common name for methane is marsh gas. Methane is a colorless flammable gas and is the main component of natural gas.
How do you calculate heating value of natural gas?
The net heating value will considering the evaporation of water formed in reaction of natural gas decomposition as follow CnHm+(n+m/4)O2=nO2+m/2H2O For Methane : CH4 we have n=1 " number of carbon m=4 " number of hydrogen then: CH4+(1+4/2)O2 O2+2H2O=CH4+3O2=2H2O Subtracting enthalpy of products from reactants to get enthalpy of decomposition
How many moles of CH4 are in 200 grams of CH4?
200 g CH4 x 1 mole CH4/16 g = 12.5 moles CH4
What is the chemical formule for methane gas?
Methane is CH4
What is the common name and use of CH4?
Are u talking about methane gas? it is used as fuel, for burning purpose.
What is the common name of CH4?
Methane :)
Common name for methane?
The common name for methane is marsh gas. Methane is a colorless flammable gas and is the main component of natural gas.
What fuel is methane?
Methane is also known as natural gas. The formula is CH4. A lot of it is burned in home heating units and in stoves.
How do you calculate heating value of natural gas?
The net heating value will considering the evaporation of water formed in reaction of natural gas decomposition as follow CnHm+(n+m/4)O2=nO2+m/2H2O For Methane : CH4 we have n=1 " number of carbon m=4 " number of hydrogen then: CH4+(1+4/2)O2 O2+2H2O=CH4+3O2=2H2O Subtracting enthalpy of products from reactants to get enthalpy of decomposition
How many moles of CH4 are in 200 grams of CH4?
200 g CH4 x 1 mole CH4/16 g = 12.5 moles CH4
What is the chemical formula of heating gas?
Assuming by heating gas you mean "natural" gas, the the formula would be CH4 which is methane. Natural gas is mostly methane with some other combustible hydrocarbons added in.
What is the chemical formule for methane gas?
Methane is CH4
Why is CH4 polar?
the CH4 poler
What do carbon and methane have in common?
Carbon is a chemical element; methane (CH4) is a chemical compound containing carbon.
What is the lower heating value of hydrogen sulfide?
Hello. Can you assist me with the calorific value of H2S and CH4 and a reference to that information? Thank you
Is ch4 molecule polar?
No. CH4 is nonpolar.
