0
The net heating value will considering the evaporation of water formed in reaction of natural gas decomposition as follow
CnHm+(n+m/4)O2=nO2+m/2H2O
For Methane : CH4 we have
n=1 " number of carbon
m=4 " number of hydrogen
then: CH4+(1+4/2)O2
O2+2H2O=CH4+3O2=2H2O
Subtracting enthalpy of products from reactants to get enthalpy of decomposition
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
What is the equation for combustion efficiency of natural gas burning furnaces?
yupe,its efficiency=Q/heating value of fuel
What common heating gas is defined by the sumbols CH4?
Methane. It has the chemical formula CH4 which is why it is called this. Common heating gas is natural gas. The main ingredient of natural gas is methane.
What does a blue flame with a yellow tip mean on a natural gas heater?
its heating
What primary fuel is used in the US for space and water heating?
Natural Gas
How does a home heating boiler work?
A home heating boiler is a woodburning water heating system that can potentially save you money on natural gas. If you cut your own wood and have an ample supply to burn, then a home heating boiler might be a great cost effective option.
Is the heating value of natural gas different in different countries?
Natural gas comes out of the ground. As a product of nature, natural gas is not the same from country to country. Methane is the main component, but metane's percentage can vary between 80% and 95%. Others hydrocarbons' percentage (for example ethane, propane, butane etc) also vary. Since heating value depends on the percentage of the hydrocarbons, heating value also varies.
How many cubic feet of natural gas to equate to 1 gallon per minute of heating oil?
It will vary somewhat with the composition of the natural gas, but roughly 133 cubic ft of natural gas has the same heat value as 1 gallon of #2 heating oil. Minutes do not enter into the calculation
How is natural gas used for heating?
gas is converted into electricty, than that is used for heating.
What is the equation for combustion efficiency of natural gas burning furnaces?
yupe,its efficiency=Q/heating value of fuel
How does oil central heating compare to gas central heating?
Oil central heating tends to be more expensive when compared to gas central heating as the price for heating oil tends to be higher when compared to natural gas. The price of heating oil also tends to be more volatile than natural gas.
What do you use natural gas for?
Natural gas is used for heating and generating electrical energy
What common heating gas is defined by the sumbols CH4?
Methane. It has the chemical formula CH4 which is why it is called this. Common heating gas is natural gas. The main ingredient of natural gas is methane.
What are the advantages of using natural gas as an energy source?
They are more enviromental friendly then coal or oil. Natural gas burns cleaner than heating oil, and does not leave product, like ash, behind. Has high heating value of 24,000 Btu per pound.
What is calor gas?
Natural gas - used for heating, cooking etc.
What is natural gas used for today?
heating boilers, gas cookers
Why is heating a home with natural gas usually the cheapest option compared to heating with electricity?
There are many reason why natural gas is usually a cheaper option for heating when compared to heating with electricity. The biggest reason is heating with therms is cheaper than kilowatts.
Can you use natural gas?
Natural gas is used for many purposes, including cooking and home heating.
