0
Pb + CrCl2 = PbCl2 + Cr
considered a redox single replacement and the Cr has a +2 charge so we assume the Pb also has a +2 because it is a transition metal
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
What is the percent yield of the decomposition reaction if 9.9 grams Pb(NO3) are heated to give an actual yield of 5.5 grams of PbO?
The yield is 82,45 %.
What do you get when you mix Pb plus 4 and OH-1?
You will get Pb(OH)4
What does BaCl2 plus F2 yield?
I suppose it would be BaF2 + Cl2.
Which ions are not spectator ions in the precipitation equation Pb(NO3)2 plus 2KI -- and gt PbI2 and nbsp plus 2KNO3?
The spectator ions in this precipitation equation are K+ and NO3-. The non-spectator ions are Pb2+ and I-. They combine to form the precipitate PbI2.
What is the correct cell notation for the redox reaction 3Pb2 plus aq plus 2Cr s 3Pb s plus 2Cr3 plus aq?
Cr(s) | Cr3+(aq) Pb2+(aq) | Pb(s)
What is the balanced equation for zinc plus lead nitrate yield zinc nitrate plus lead?
Equation is Zn + Pb(NO3)2 --> Zn(NO3)2 + Pb
What is the percent yield of the decomposition reaction if 9.9 grams Pb(NO3) are heated to give an actual yield of 5.5 grams of PbO?
The yield is 82,45 %.
How to balance Pb plus pbo2 plus h2so4 H2O plus pbso4?
Pb + PbO2 + H2SO4 --> PbSO4 + H2O
Coding in c plus plus to swap two nos using pointer?
void swap (int &pa, int &pb) { *pa ^= *pb; *pb ^= *pa; *pa ^= *pb; }
How does Pb 2 plus become Pb 4 plus?
a peanut buter and jelly or jam sandwich
What do you get when you mix Pb plus 4 and OH-1?
You will get Pb(OH)4
How do you balance Pbo plus C equals Pb plus CO2?
2 PbO + C -> 2 Pb + CO2
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the total number of electrons in an Pb plus 4?
Pb which is neutral has 82 electrons. Thus, if it has a 4+ charge, then it has 78 electrons.
Nmae the following compound Pb plus 2?
Lead (II)
What is the reaction equation for Pb NO3 2 plus KI?
yhujuhj
Does hydrogen plus water yield water?
No. Hydrogen reacts with oxygen to yield water.
