A scientific name is dihydrogen oxide.
The formula is H2O, of course. The long way to say/write it is Dihydrogen Monoxide.You answered it in your question. Scientific formula is showing a compound (in this case, water) with all of the chemicals it's made up of. H=hydrogen O=oxygen 2=two hydrogens hx2. So the formula is all of the parts that go together to make up water. Water is the compound name for h2o
H2O is the chemical formula of water.
a molecular formula
For correction purposes the correct way to write this is H2O and it is the chemical formula for water.
the scientific formula is H2O
H2O is the formula for water.
H2O = 2 Hydrogen atoms + 1 Oxygen atom = H2O, Or widely known as "water"Yea.. Im smart :P
A scientific name is dihydrogen oxide.
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
The formula is H2O. The name of this compound is water.
H2O is the chemical formula of water.
h2o is the scientific name for water.
H2O is the chemical formula for water.
Formula: H2O
The formula is H2O, of course. The long way to say/write it is Dihydrogen Monoxide.You answered it in your question. Scientific formula is showing a compound (in this case, water) with all of the chemicals it's made up of. H=hydrogen O=oxygen 2=two hydrogens hx2. So the formula is all of the parts that go together to make up water. Water is the compound name for h2o
H2O is a chemical formula for water.