0
Fluoropropane
Anonymous
Add your answer:
Earn +20 pts
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the name for ch3chch3chch3ch3?
The name for CH3CH(CH3)CH(CH3)CH3 is 2,3-dimethylpentane.
What is the extended structural formula of 2-methyl propane?
Difficult to draw here, but let's try to describe: Three methyl groups (CH3-) and one H- atom bonded to one central C atom, then you'll get something like this: . . . .H CH3-C-CH3 . . . .CH3
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What is KB for ch3 3n aq h2o l ch3 3nh aq oh-aq?
Kb=[(Ch3)3 NH+][OH-] __________ [(Ch3)3 N]
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What’s 2×4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
Chemical reaction of 2-Butene?
2-butene is an alkene which may undergo several addition reactions as Hydrohalogenaton, Halogenation, Hydration, Catalytic hydrogenation, Hydroxylation and so many others some are as follows.. CH3-CH=CH-CH3 + HCl -----------> CH3-CH2-CHCl-CH3 CH3-CH=CH-CH3 + Cl2 ------------> CH3-CHCl-CHCl-CH3 CH3-CH=CH-CH3 + H2O ----H+---> CH3-CH2-CHOH-CH3
What is 2-2-4-4-tetramethylpentane?
2,2,4,4-tetramethylpentane is a branched-chain hydrocarbon with the chemical formula C9H22. It is commonly used as a reference compound in gas chromatography because of its unique structure and boiling point.
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
Can you make two structural isomers from a saturated alkane C4H10?
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
what is the formula for "2-bromo-2-methylpropane + H2O →2-methylpropan-2-ol + HBr"?
CH3-C(Br)(CH3)-CH3 + H2O = CH3-C(OH)(CH3)-CH3 + HBr
What is the name of ch3-ch2-ch2-ch3 with single bondof ch3?
Butane
Is -CH3 in a functional group?
CH3 is.
