Tags Taxonomy

Animals & Plants Arts & Entertainment Auto Beauty & Health Books and Literature Business Electronics Engineering & Technology Food & Drink History Hobbies Jobs & Education Law & Government Math People & Society Science Social Studies Sports Travel & Places

0

Subjects>Social Studies>Information Science

What is CO2 scientific name?

Updated: 4/26/2024

Wiki User

∙ 11y ago

Best Answer

Carbon Dioxide

Wiki User

∙ 14y ago

This answer is:

More answers

∙ 3d ago

Carbon dioxide (CO2) is a chemical compound consisting of one carbon atom bonded to two oxygen atoms.

This answer is:

Wiki User

∙ 11y ago

CO2 scientific name is carbon dioxide.

This answer is:

Add your answer:

Earn +20 pts

Q: What is CO2 scientific name?

Write your answer...

Submit

Still have questions?

imp

Continue Learning about Information Science

What is the scientific name for chrysanthemums?

The scientific name for chrysanthemums is Chrysanthemum spp.

Squid scientific name?

The scientific name for squids is Decapodiformes.

What is the scientific name for cnidaria?

The scientific name for cnidaria is Cnidaria.

Barracuda's scientific name?

The barracuda's scientific name is Sphyraena. =)

What is the scientific name for Echinoderms?

The scientific name for Echinoderms is Echinodermata.

Related questions

What is the scientific name of natural gas?

Co2

What is the scientific name for natural gas?

co2

What is the scientific name for fizz in soda pop?

The scientific term for something that is fizzing or producing bubbles is effervescent.

What is the scientific notation for carbon?

your write co2

Give scientific reason that you walk on the earth?

gravity,oxygen and co2

What is the preferred name for the chemical compound CO2?

Chemical formula CO2 is the name of carbon dioxide.

What is the scientific name for nature?

co2

What is the process of taking in air into your body and giving it out is called?

Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O

What is the scientific name for chrysanthemums?

The scientific name for chrysanthemums is Chrysanthemum spp.

Name the covalent compound CO2?

Carbon monoxide.

Give the name of CO2?

CO2 is the chemical formula of carbon dioxide.

What is scientific name of euphorbia?

That is the scientific name

Trending Questions

What taxon includes the broadest characteristics? What is different classification of appetires? What is the scientific name for desert tortiose? What is the scientific name for bears? What is the scientific name for a toy fox terrier? What is the difference between cbse and cbse-i? What kind of information do the wikipedia sources provide? Do eukaryotes have a true nucleus? What is the scientific name of a blow fly? What is the difference between a procedural and a non-procedural language IN DBMS? Whose system of classifying and naming organisms is still in use today? Can you please send marks list of ssc 2009 hall ticket no--03117475.? What is the scientific name or taxonomic classification of the shellfish Freshwater shrimp? On average how long does it take to complete CISSP certification training? What is data abstruction in dbms? Why are Database queries useful? Is the word information masculine or feminine in French? What is the scientific name of animal fur? What is the scientific name for a spotted hyena? Is a honey bee a vertebrate or an invertebrate?

Still have questions?

imp

Previously Viewed

What is CO2 scientific name?

Resources

Top Categories

Product

Company

Copyright ©2024 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.