0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
How many isomers of C8H10 are there?
Butane C4H10 has 2 isomersbutane C-C-C-C (n-butane)2-methyl propane CH3)2-CH-CH3 (isobutane)
What does O C N H mean?
O is Oxygen C is Carbon N is Nitrogen H is Hydogen Is that what you mean?
Can you make two structural isomers from a saturated alkane C4H10?
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
The number of protons neutrons electrons in H C N O?
Respectively: H-1,0,1 C-6,6,6 N-7,7,7 O-8,7,8
What is the molecular formula of CTAB?
[(C16H33)N(CH3)(CH3)(CH3)]BrCHEMICAL NAME - Cetyl Tri Methyl ammonium Bromide
The oxime formed when Butanone reacts with NH2OH exhibits?
C2h5-c(ch3)=n-oh
What is the Lewis dot structure of butane?
There are a two different forms of butane, depending on how the atoms are connected. All have 4 carbon and 10 hydrogen atoms, but one is a linear structure (called n-butane), another is branched once (called isobutane). See the Related Questions for how to draw the Lewis dot structure, but the atoms are connected as follows: n-butane: H3C-CH2-CH2-CH3 isobutane (CH3)3CH
What is C2H6 called?
C2H6 is ETHANE . Structurally it is 'CH3 - CH3 '. It follows the general formula for alkanes , ; C(n)H(2n + 2).
What is Kb for (CH3)3N(aq) H2O(l) (CH3)3NH (aq) OH-(aq)?
Kb=[(Ch3)3 NH+][OH-]/[(Ch3)3 N]
What is KB for ch3 3n aq h2o l ch3 3nh aq oh-aq?
Kb=[(Ch3)3 NH+][OH-] __________ [(Ch3)3 N]
What is do the molecules of C3H7O2N look like?
H H O | | H - N - C - C - OH | H - C - H | H
What are the different types of organic reaction?
Addition Reactions - involve the conversion of a π bond into 2 new σ bonds General form: A + B → C Eg. CH3-CH=CH-CH3 + HCl → CH3-CH2-CHCl-CH3 Substitution Reactions - involve the no change in bonding - one σ bond replaces another General form: A + B → C + D Eg. CH3-CHBr-CH2-CH3 + KOH(aq) → CH3-CH(OH)-CH2-CH3 + KBr Elimination Reactions - reverse of addition, in that two σ bonds are lost, replaced by a new π bond General form: A → B + C Eg. CH3-CH(OH)-CH2-CH3 -- conc. H2SO4 --> CH3-CH=CH-CH3 + H2O Rearrangement / Isomerisation - process in which a single substance changes structure, A → B. Such a reaction may involve changes in bond / type, though this is not necessary. These reactions are comparatively rare. Eg. CH3-CH2-CH2-C(OH)=CH2 → CH3-CH2-CH2-C(=O)-CH3 These are the four "prototypical" reactions, though several others which can be categorised as one of these are generally referred to by other names. Eg. CH3-CH(OH)-CH3 -- H2SO4 / K2Cr2O7 --> CH3-C(=O)-CH3 could be described as an elimination reaction, but would usually be called an oxidation Eg. CH3-C(=O)-CH3 -- 1. LiAlH4 2. H^+ / H2O --> CH3-CH(OH)-CH3 could be described as a (nucleophilic) addition reaction, but would usually be called a reduction Eg. CH3-C(=O)-OH + CH3-OH -- H2SO4 / Δ / reflux --> CH3-C(=O)-O-CH3 + H2O could be described as a substitution reaction, but would usually be called a condensation Another important category of organic reactions are straight-forward Lowry-Bronsted acid-base reactions: Eg. (CH3-CH2)3N + HCl → (CH3-CH2)3NH^+ + Cl^- Note that there are also some reactions that are difficult to characterise in a simple way, like the following reactions requiring catalysis: stilbene + ethylene → styrene C6H5-CH=CH-C6H5 + CH2=CH2 → 2 C6H5-CH=CH2 but-1-yne + water → butanone CH3-CH2-C≡CH + H2O → CH3-CH2-C(=O)-CH3 (this is actually an addition reaction followed by an isomerisation) CH3-CH2-C(=O)-CH3 + NH2-OH → CH3-CH2-C(=N-OH)-CH3 + H2O the pinacol to pinacolone rearrangement CH3-C(CH3)(OH)-C(CH3)(OH)-CH3 → CH3-C(CH3)2-C(=O)-CH3 which is an elimination reaction that involves an isomerisation ... I add these last few just to illustrate that the general types are a useful tool / guide for understanding organic chemistry, but they are not the be-all and end-all.
Please identify this H-N-C-CH2-CH3?
You have carbon with two bonds. Unless you meant carbEne you are mistaken.
What formula is represents an amino acid?
H2N-CHR-COOH Structure: H H O | | N - C - C | | | H R OH
What formula represents amino acids?
H2N-CHR-COOH Structure: H H O | | N - C - C | | | H R OH
What is the chemical formula of rubber.?
[CH2=C(CH3)CH-CH2-] n approximately where n is > 250 usually but also [-----CH2-CH(CH3)CH-CH2-] n etc BASICALLY ISOPRENE CH2=C(CH3)CH=CH2 polymerized
What formula represents an amino acid?
H2N-CHR-COOH Structure: H H O | | N - C - C | | | H R OH
