0
What is Kb for CH3 NH2 (aq) plus H2O(l) CH3NH3 plus (aq) plus OH-(aq)?
Wiki User
∙ 7y agoWant this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What type of reaction is Al plus 3Hg(CH3)2 yields Al(CH3) plus 3Hg?
This reaction is called "metal-metal exchange reaction".
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
Chemical reaction of 2-Butene?
2-butene is an alkene which may undergo several addition reactions as Hydrohalogenaton, Halogenation, Hydration, Catalytic hydrogenation, Hydroxylation and so many others some are as follows.. CH3-CH=CH-CH3 + HCl -----------> CH3-CH2-CHCl-CH3 CH3-CH=CH-CH3 + Cl2 ------------> CH3-CHCl-CHCl-CH3 CH3-CH=CH-CH3 + H2O ----H+---> CH3-CH2-CHOH-CH3
Can you make two structural isomers from a saturated alkane C4H10?
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
What is the name of ch3-ch2-ch2-ch3 with single bondof ch3?
Butane
What is the shape bond angle and hybridization of plus CH3?
CH3 is a trigonal planar and has a hybridization of sp3
Is Al plus 3Hg(CH3)2 yields Al(CH3)3 plus 3Hg a precipitation reaction?
Trimethyl aluminium is not a solid precipitate.
What is the electron geometry of CH3 plus?
Trigonal Planar
What is the molecular geometry of CH3 plus?
Trigonal Planar
What type of reaction is Al plus 3Hg(CH3)2 yields Al(CH3) plus 3Hg?
This reaction is called "metal-metal exchange reaction".
Which species is formed when the CH3N2 plus cation loses a nitrogen molecule?
CH3+
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What’s 2×4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
Chemical reaction of 2-Butene?
2-butene is an alkene which may undergo several addition reactions as Hydrohalogenaton, Halogenation, Hydration, Catalytic hydrogenation, Hydroxylation and so many others some are as follows.. CH3-CH=CH-CH3 + HCl -----------> CH3-CH2-CHCl-CH3 CH3-CH=CH-CH3 + Cl2 ------------> CH3-CHCl-CHCl-CH3 CH3-CH=CH-CH3 + H2O ----H+---> CH3-CH2-CHOH-CH3
What is 2-2-4-4-tetramethylpentane?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
