Oxygen's scientific name is simply "oxygen." It is a chemical element with the symbol O and atomic number 8.
The scientific name for chrysanthemums is Chrysanthemum spp.
The scientific name for squids is Decapodiformes.
The scientific name for cnidaria is Cnidaria.
The barracuda's scientific name is Sphyraena. =)
The scientific name for Echinoderms is Echinodermata.
It does not have a generic name or a trade name. It's always just Oxygen. Sorry.
The chemical formula for oxygen is O2.
O2
O2
Oxygen is the scientific name. Chemically, you can describe it as O2, as it exists of 2 oxygen molecules with a double (covalent?) binding if I'm not mistaken. An oxygen molecule has 2 free electrons, so combine two and you have a nice stable structure called oxygen. Scematic: O=O or O2
Plants produce oxygen (O2).
nga .o2 curiosity by mariella :)
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
The scientific term is O2. It consists of part oxygen, nitrogen primarily.
The scientific name for chrysanthemums is Chrysanthemum spp.
That is the scientific name
That IS the scientific name.