0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the product of the reaction between butanoic acid and amyl alcohol?
Amyl butyrate an ester that is formed when pentanol is reacted with butyric acid, in order this reaction to proceed the presence of acid like H2SO4 is needed
What ester does butyric acid and amyl alcohol form?
Amyl butyrate, CH3[CH2]2C(=O)-O[CH2]4CH3, IUPAC name: pentyl butanoate This ester has a smell reminiscent of pear or apricot. This chemical is used as an flavour added to cigarette- and pipe tobaccos.
What is potassium butyrate used for?
Potassium butyrate is used in food additives; but the efficacy is not confirmed scientifically, a hoax is possible.
Why amyl alcohol and sulphuric acid is used in gerber's method?
sulfuric acid digests the proteins and amyl alcohol gives clear fat column
What does methyl butyrate smell like?
Methyl butyrate smell like apples.
Amyl nitrite inhalant?
Yes, it can be used as an inhalant - was that what you wanted to know?
What kind of organic compound is Amyl nitrite?
its used for angina pectoris
What is amyl?
An amyl is a dated name in organic chemistry for pentyl.
Is Butyl Alcohol a reactants used to make methyl butyrate?
the reactants are methanol and butyric acid
What is artificial strawberry flavoring made of?
A typical artificial strawberry flavor, like the kind found a milk shake, contains the following ingredients:amyl acetate, amyl butyrate, amyl valerate,anethol,anisyl formate,benzyl acetate, benzyl isobutyrate, butyric acid,cinnamyl isobutyrate, cinnamyl valerate,cognac essential oil,diacetyl,dipropyl ketone,ethyl acetate, ethyl amyl ketone, ethyl butyrate, ethyl cinnamate, ethyl heptanoate, ethyl heptylate, ethyl lactate, ethyl methylphenylglycidate,ethyl nitrate, ethyl propionate, ethyl valerate,heliotropin,hydroxyphenyl-2-butanone (10 percent solution in alcohol),a-ionone,isobutyl anthranilate, isobutyl butyrate,lemon essential oil,maltol,4-methylacetophenone,methyl anthranilate, methyl benzoate, methyl cinnamate, methyl heptine carbonate, methyl naphthyl ketone, methyl salicylate,mint essential oil,neroli essential oil,nerolin,neryl isobutyrate,orris butter,phenethyl alcohol,rose,rum ether,g-undecalactone,vanilli.
What is the meaning of the root word amyl?
The root word "amyl" refers to a group of organic compounds containing five carbon atoms. It is often found in the names of chemical compounds like amyl alcohol or amyl nitrite.
What are the three components in order of administration used to treat cyanide exposure?
Amyl nitrite, sodium nitrite, sodium thiosulfate
