0
Amyl butyrate, CH3[CH2]2C(=O)-O[CH2]4CH3, IUPAC name: pentyl butanoate
This ester has a smell reminiscent of pear or apricot. This chemical is used as an flavour added to cigarette- and pipe tobaccos.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
Can iso amyl alcohol replace phenol in DNA extraction?
No
What type of flame would have for the combustion of amyl alcohol have?
Cool flame, yellow & orange
What is artificial strawberry flavoring made of?
A typical artificial strawberry flavor, like the kind found a milk shake, contains the following ingredients:amyl acetate, amyl butyrate, amyl valerate,anethol,anisyl formate,benzyl acetate, benzyl isobutyrate, butyric acid,cinnamyl isobutyrate, cinnamyl valerate,cognac essential oil,diacetyl,dipropyl ketone,ethyl acetate, ethyl amyl ketone, ethyl butyrate, ethyl cinnamate, ethyl heptanoate, ethyl heptylate, ethyl lactate, ethyl methylphenylglycidate,ethyl nitrate, ethyl propionate, ethyl valerate,heliotropin,hydroxyphenyl-2-butanone (10 percent solution in alcohol),a-ionone,isobutyl anthranilate, isobutyl butyrate,lemon essential oil,maltol,4-methylacetophenone,methyl anthranilate, methyl benzoate, methyl cinnamate, methyl heptine carbonate, methyl naphthyl ketone, methyl salicylate,mint essential oil,neroli essential oil,nerolin,neryl isobutyrate,orris butter,phenethyl alcohol,rose,rum ether,g-undecalactone,vanilli.
What temperature does everclear boil?
73 degrees centigrade Actually, it depends on the type of alcohol Isopropanol (typical rubbing alcohol): 82.5 degrees celsius Ethanol (drinking alcohol):78.4 degrees celsius Then there are many, many others. The better known ones are Methanol, Butanol, Amyl alcohol, Ethylene glycol, Propylene Glycol, Glycerol, Sorbitol, Menthol
Is pentanol man made or naturally made?
There are 8 different pentanols, (also called amyl alcohols), some of which, including pentan-1-ol, occur in fusel alcohol. Fusel alcohol is a by product of the fermentation process which produces ethanol. Thus at least some of the penanols are likely to occur in natural fermentation processes. Others are largely produced synthetically.https://en.wikipedia.org/wiki/Amyl_alcohol
What is the product of the reaction between butanoic acid and amyl alcohol?
Amyl butyrate an ester that is formed when pentanol is reacted with butyric acid, in order this reaction to proceed the presence of acid like H2SO4 is needed
What smell does the ester from n-amyl alcohol and acetic acid have?
banana
What ester forms when ethyl alcohol and formic acid react?
The products from the reaction of n-amyl alcohol and acetic acid are ethyl pentanoate (an ester) and water. CH3COOH + CH3CH2CH2CH2CH2OH ==> CH3COOCH2CH2CH2CH2CH3 + H2O acetic acid + n-amyl alcohol ==> ethyl propanoate + water
Why amyl alcohol and sulphuric acid is used in gerber's method?
sulfuric acid digests the proteins and amyl alcohol gives clear fat column
Can iso amyl alcohol replace phenol in DNA extraction?
No
What is the chemical formula for the product of 1-pentanol and acetic acid?
The reaction for 1-pentanol and acetic acid produces amyl acetate as a condensate. This ester has the chemical formula of CH3COO[CH2]4CH3.
How is the Gerber method of fat estimation done?
By adding sulphuric acid to remove it from the proteins, (sped up by addition of amyl alcohol , waterbath at 65 degree and a centrifuge all in a butyometer(spelling?).....
What is the principle involved in determining fat content using Gerber method?
By adding sulphuric acid the MFGM rupture &iso amyl alcohol dissolve fat during centrifugation fat is separate
What type of flame would have for the combustion of amyl alcohol have?
Cool flame, yellow & orange
What is the odor 1-pentanol and acetic acid?
Amyl Acetate is formed from 1-pentanol and acetic acid. This smells like bananas
What are the Gerber test milk analysis procedures?
The Gerber Method is a chemical test to determine the fat content of substances, mainly milk and cream. Milk fat is separated from proteins with the help of sulfuric acid. amyl alcohol and centrifugation is used along with sulfuric acid to facilitate the separation process.
What is amyl?
An amyl is a dated name in organic chemistry for pentyl.
