answersLogoWhite

0


Best Answer

Cool flame, yellow & orange

User Avatar

Wiki User

13y ago
This answer is:
User Avatar

Add your answer:

Earn +20 pts
Q: What type of flame would have for the combustion of amyl alcohol have?
Write your answer...
Submit
Still have questions?
magnify glass
imp
Related questions

Why amyl alcohol and sulphuric acid is used in gerber's method?

sulfuric acid digests the proteins and amyl alcohol gives clear fat column


Can iso amyl alcohol replace phenol in DNA extraction?

No


What smell does the ester from n-amyl alcohol and acetic acid have?

banana


What is the product of the reaction between butanoic acid and amyl alcohol?

Amyl butyrate an ester that is formed when pentanol is reacted with butyric acid, in order this reaction to proceed the presence of acid like H2SO4 is needed


What is amyl?

An amyl is a dated name in organic chemistry for pentyl.


Is Amyl alcohol soluble in water?

Yes, it is slightly soluble. However, your question is not specific enough. Amyl alcohol occurs as several isomers, i.e. same molecular weight (88.1) and formula (C5H12O) but different bond structure between the atoms. The solubility depends on which isomer you are refering to. e.g. n-amyl alcohol (also called 1-pentanol) = 2.7 g per 100g water at 60 deg F iso-amyl alcohol = 2g/100g 2-pentanol = 4 g/100g 3-pentanol = 5.5 g/100g There are a few other isomers as well. Check out Perry's Handbook of Chemical Engineering, published by McGraw-Hill Book Company, NY


What ester does butyric acid and amyl alcohol form?

Amyl butyrate, CH3[CH2]2C(=O)-O[CH2]4CH3, IUPAC name: pentyl butanoate This ester has a smell reminiscent of pear or apricot. This chemical is used as an flavour added to cigarette- and pipe tobaccos.


Why did you not wash the crude t-pentyl chloride with aqueous sodium hydroxide?

Because I think that t-pentyl alcohol and sodium chloride will be produced. t-penyl alcohol is also known as tert-amyl alcohol or 2-methyl-2-butanol.


Is denatured alcohol an alcohol?

It is a mixture of two alcohols: ethanol and methanol. <><><> The term Denatured refers to ethyl alcohol that has another substance mixed in that prevents it from being drunk. It may be methanol, unleaded gasoline, or amyl acetate. Denatured alcohol is poisonous to drink, and is used for industrial processes,


What ester forms when ethyl alcohol and formic acid react?

The products from the reaction of n-amyl alcohol and acetic acid are ethyl pentanoate (an ester) and water. CH3COOH + CH3CH2CH2CH2CH2OH ==> CH3COOCH2CH2CH2CH2CH3 + H2O acetic acid + n-amyl alcohol ==> ethyl propanoate + water


What is the birth name of Max Amyl?

Max Amyl's birth name is Chiapale, Max Gabriel Emmanuel Louis.


When did Max Amyl die?

Max Amyl died on March 2, 1982, in Limoges, Haute-Vienne, France.