0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
Is particulate carbon is another name for soot?
Yes it is.
What the air is like outside is called?
The air outside is called atmospheric air or outdoor air. It consists of a mixture of gases including nitrogen, oxygen, carbon dioxide, and others, as well as various pollutants and particulate matter.
What is the visible smoke emitted from burning wood called?
Particulate Matter.....
The allotrope of carbon bucky ball?
There are eight allotropes of carbon. Bucky ball is one of the allotrope of carbon. Bucky ball is also called fullerene
What are 5 substances found in air?
H2O(Water; particularly vapor), CO2(Carbon dioxide), CH4(Methane), N2O(Nitrous oxide), Particulate Matter, and CFCs(Chlorofluorocarbons)
Is particulate carbon is another name for soot?
Yes it is.
What produces particulate carbon?
The effects of inhaling carbon particulate matter have been widely studied in humans and animals and include asthma, lung cancer, cardiovascular issues, and premature death.
Why is removing carbon from the air important?
Particulate carbon in the air causes smog and can cause respiratory distress.
How are carbon monoxide and particulate carbon made?
they are the products of INCOMPLETE COMBUSTION (aka burning)
What are the names of the gases produced by the vechiles?
Carbon monoxide, hydrocarbons, sulfur oxides, particulate matter, and nitrogen oxides (There are also bromine emissions from leaded gasoline).
What are the 3 main atmospheric pollutants?
There are many, including Ozone, Carbon Monoxide, and Particulate Matter.
What the air is like outside is called?
The air outside is called atmospheric air or outdoor air. It consists of a mixture of gases including nitrogen, oxygen, carbon dioxide, and others, as well as various pollutants and particulate matter.
Why carbon monoxide is not called carbon oxide?
Because also exist the carbon dioxide - CO2.
What is the reaction between antibody and particulate antigens called?
agglutination reaction
What is the visible smoke that is emitted from burning wood is called?
particulate matter
What is the visible smoke emitted from burning wood called?
Particulate Matter.....
What posinouse gas do forest fires let out?
The top 2 most concerned ones are carbon monoxide and particulate matter
