0
Atomic number remains same for another isotope but only mass number changes. So it will be 1
Wiki User
∙ 13y ago
Wiki User
∙ 14y ago4
Add your answer:
Earn +20 pts
What is the reaction for the preparation of ethylene dibromide from ethene?
When ethyl chloride is reduced with atomic hydrogen ethane and HCl are formed, Zn + 2HCl -------> ZnCl2 + 2[H] CH3-CH2-Cl + 2[H] -----> CH3-CH3 + HCl
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is an example of Atomic Number?
Atomic number= number of protons. Hydrogen atomic number=1
What is the atomic number of F plus the atomic number of Na?
The atomic number of fluorine is 9.The atomic number of sodium is 11.
Chemical reaction of 2-Butene?
2-butene is an alkene which may undergo several addition reactions as Hydrohalogenaton, Halogenation, Hydration, Catalytic hydrogenation, Hydroxylation and so many others some are as follows.. CH3-CH=CH-CH3 + HCl -----------> CH3-CH2-CHCl-CH3 CH3-CH=CH-CH3 + Cl2 ------------> CH3-CHCl-CHCl-CH3 CH3-CH=CH-CH3 + H2O ----H+---> CH3-CH2-CHOH-CH3
What is the atomic symbol of ethane?
Ethane is not an atom, but a molecule whose condensed formula is H3C - CH3
What does a single straight line (-CH3) extending from an atomic symbol represent?
Single covalent bond.
What is the reaction for the preparation of ethylene dibromide from ethene?
When ethyl chloride is reduced with atomic hydrogen ethane and HCl are formed, Zn + 2HCl -------> ZnCl2 + 2[H] CH3-CH2-Cl + 2[H] -----> CH3-CH3 + HCl
What is the number of protons in the neucleus called?
the answer is that it is called a atomic number.
Atomic number in the atomic nucleus?
The atomic number is equal to the number of the protons in the atomic nucleus.
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
The number of neutrons in an atom can be found by subtracting the atomic number from the?
Atomic weight in atomic mass units = the number of protons + the number of neutrons. The number of protons is your atomic number. Subtract that from the atomic weight for the number of neutrons.
What’s 2×4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
This element has an atomic number that is double the atomic number of silicon?
this elemnt has an atomic number that is double the atomic number of silicon?
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
What is the number of neutrons in an atomic number?
Subtract the atomic number from the atomic weight.
